About 1-piperidin-4-ylethenol
1-piperidin-4-ylethenol (PubChem CID 70315961) has the molecular formula C7H13NO
and a molecular weight of 127.19 g/mol. Its IUPAC name is 1-piperidin-4-ylethenol.
Molecular Properties
| Compound Name | 1-piperidin-4-ylethenol |
| PubChem CID | 70315961 |
| Molecular Formula | C7H13NO |
| Molecular Weight | 127.19 g/mol |
| Exact Mass | 127.10 |
| IUPAC Name | 1-piperidin-4-ylethenol |
| SMILES | C=C(O)C1CCNCC1 |
| InChI | InChI=1S/C7H13NO/c1-6(9)7-2-4-8-5-3-7/h7-9H,1-5H2 |
| InChIKey | DLHYGJZQKQJJMZ-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.19 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 1-piperidin-4-ylethenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-piperidin-4-ylethenol?
The IUPAC name of 1-piperidin-4-ylethenol (CID 70315961) is 1-piperidin-4-ylethenol.
What is the SMILES notation for 1-piperidin-4-ylethenol?
The canonical SMILES for 1-piperidin-4-ylethenol is C=C(O)C1CCNCC1.
What is the InChIKey of 1-piperidin-4-ylethenol?
The InChIKey is DLHYGJZQKQJJMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO/c1-6(9)7-2-4-8-5-3-7/h7-9H,1-5H2.
What are the key properties of 1-piperidin-4-ylethenol?
1-piperidin-4-ylethenol has a molecular weight of 127.19 g/mol, XLogP of 1.06, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-piperidin-4-ylethenol is sourced from PubChem (CID 70315961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).