C21H19F5O4S — CID 70316175
[(7R,10aS)-1,4-difluoro-10a-[4-(trifluoromethyl)phenyl]sulfonyl-6,6a,7,8,9,10-hexahydrobenzo[c]chromen-7-yl]methanol (PubChem CID 70316175) has the molecular formula C21H19F5O4S and a molecular weight of 462.44 g/mol. Its IUPAC name is [(7R,10aS)-1,4-difluoro-10a-[4-(trifluoromethyl)phenyl]sulfonyl-6,6a,7,8,9,10-hexahydrobenzo[c]chromen-7-yl]methanol.
| Compound Name | [(7R,10aS)-1,4-difluoro-10a-[4-(trifluoromethyl)phenyl]sulfonyl-6,6a,7,8,9,10-hexahydrobenzo[c]chromen-7-yl]methanol |
|---|---|
| PubChem CID | 70316175 |
| Molecular Formula | C21H19F5O4S |
| Molecular Weight | 462.44 g/mol |
| Exact Mass | 462.09 |
| IUPAC Name | [(7R,10aS)-1,4-difluoro-10a-[4-(trifluoromethyl)phenyl]sulfonyl-6,6a,7,8,9,10-hexahydrobenzo[c]chromen-7-yl]methanol |
| SMILES | O=S(=O)(c1ccc(C(F)(F)F)cc1)[C@@]12CCC[C@@H](CO)C1COc1c(F)ccc(F)c12 |
| InChI | InChI=1S/C21H19F5O4S/c22-16-7-8-17(23)19-18(16)20(9-1-2-12(10-27)15(20)11-30-19)31(28,29)14-5-3-13(4-6-14)21(24,25)26/h3-8,12,15,27H,1-2,9-11H2/t12-,15?,20-/m0/s1 |
| InChIKey | IODISKWOIXTJAT-CHHXXQPCSA-N |
| XLogP | 4.45 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.44 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |