C16H24FNO3 — CID 70316222
(2R,3S,4S)-1-benzyl-4-fluoro-2-[2-(2-hydroxypropan-2-yloxy)ethyl]pyrrolidin-3-ol (PubChem CID 70316222) has the molecular formula C16H24FNO3 and a molecular weight of 297.37 g/mol. Its IUPAC name is (2R,3S,4S)-1-benzyl-4-fluoro-2-[2-(2-hydroxypropan-2-yloxy)ethyl]pyrrolidin-3-ol.
| Compound Name | (2R,3S,4S)-1-benzyl-4-fluoro-2-[2-(2-hydroxypropan-2-yloxy)ethyl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 70316222 |
| Molecular Formula | C16H24FNO3 |
| Molecular Weight | 297.37 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | (2R,3S,4S)-1-benzyl-4-fluoro-2-[2-(2-hydroxypropan-2-yloxy)ethyl]pyrrolidin-3-ol |
| SMILES | CC(C)(O)OCC[C@@H]1[C@H](O)[C@@H](F)CN1Cc1ccccc1 |
| InChI | InChI=1S/C16H24FNO3/c1-16(2,20)21-9-8-14-15(19)13(17)11-18(14)10-12-6-4-3-5-7-12/h3-7,13-15,19-20H,8-11H2,1-2H3/t13-,14+,15+/m0/s1 |
| InChIKey | DQNPYLBTTZCFCR-RRFJBIMHSA-N |
| XLogP | 1.70 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.37 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|