C25H32N2O3 — CID 70316229
3-[(8R)-8-(3-hydroxyphenyl)-7,8-dimethyl-3-phenyl-3,4,6,7,9,9a-hexahydro-1H-pyrido[1,2-a]pyrazin-2-yl]propanoic acid (PubChem CID 70316229) has the molecular formula C25H32N2O3 and a molecular weight of 408.54 g/mol. Its IUPAC name is 3-[(8R)-8-(3-hydroxyphenyl)-7,8-dimethyl-3-phenyl-3,4,6,7,9,9a-hexahydro-1H-pyrido[1,2-a]pyrazin-2-yl]propanoic acid.
| Compound Name | 3-[(8R)-8-(3-hydroxyphenyl)-7,8-dimethyl-3-phenyl-3,4,6,7,9,9a-hexahydro-1H-pyrido[1,2-a]pyrazin-2-yl]propanoic acid |
|---|---|
| PubChem CID | 70316229 |
| Molecular Formula | C25H32N2O3 |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.24 |
| IUPAC Name | 3-[(8R)-8-(3-hydroxyphenyl)-7,8-dimethyl-3-phenyl-3,4,6,7,9,9a-hexahydro-1H-pyrido[1,2-a]pyrazin-2-yl]propanoic acid |
| SMILES | CC1CN2CC(c3ccccc3)N(CCC(=O)O)CC2C[C@@]1(C)c1cccc(O)c1 |
| InChI | InChI=1S/C25H32N2O3/c1-18-15-27-17-23(19-7-4-3-5-8-19)26(12-11-24(29)30)16-21(27)14-25(18,2)20-9-6-10-22(28)13-20/h3-10,13,18,21,23,28H,11-12,14-17H2,1-2H3,(H,29,30)/t18?,21?,23?,25-/m1/s1 |
| InChIKey | UFCPBRSMWGRTKH-DUYDWSHLSA-N |
| XLogP | 3.89 |
| TPSA | 64.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |