About 5-(1,2-difluoro-2-methylpropyl)cyclohexa-1,3-diene-1-carbonitrile
5-(1,2-difluoro-2-methylpropyl)cyclohexa-1,3-diene-1-carbonitrile (PubChem CID 70316371) has the molecular formula C11H13F2N
and a molecular weight of 197.23 g/mol. Its IUPAC name is 5-(1,2-difluoro-2-methylpropyl)cyclohexa-1,3-diene-1-carbonitrile.
Molecular Properties
| Compound Name | 5-(1,2-difluoro-2-methylpropyl)cyclohexa-1,3-diene-1-carbonitrile |
| PubChem CID | 70316371 |
| Molecular Formula | C11H13F2N |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | 5-(1,2-difluoro-2-methylpropyl)cyclohexa-1,3-diene-1-carbonitrile |
| SMILES | CC(C)(F)C(F)C1C=CC=C(C#N)C1 |
| InChI | InChI=1S/C11H13F2N/c1-11(2,13)10(12)9-5-3-4-8(6-9)7-14/h3-5,9-10H,6H2,1-2H3 |
| InChIKey | DBXGOANUHWGCMO-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-(1,2-difluoro-2-methylpropyl)cyclohexa-1,3-diene-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1,2-difluoro-2-methylpropyl)cyclohexa-1,3-diene-1-carbonitrile?
The IUPAC name of 5-(1,2-difluoro-2-methylpropyl)cyclohexa-1,3-diene-1-carbonitrile (CID 70316371) is 5-(1,2-difluoro-2-methylpropyl)cyclohexa-1,3-diene-1-carbonitrile.
What is the SMILES notation for 5-(1,2-difluoro-2-methylpropyl)cyclohexa-1,3-diene-1-carbonitrile?
The canonical SMILES for 5-(1,2-difluoro-2-methylpropyl)cyclohexa-1,3-diene-1-carbonitrile is CC(C)(F)C(F)C1C=CC=C(C#N)C1.
What is the InChIKey of 5-(1,2-difluoro-2-methylpropyl)cyclohexa-1,3-diene-1-carbonitrile?
The InChIKey is DBXGOANUHWGCMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13F2N/c1-11(2,13)10(12)9-5-3-4-8(6-9)7-14/h3-5,9-10H,6H2,1-2H3.
What are the key properties of 5-(1,2-difluoro-2-methylpropyl)cyclohexa-1,3-diene-1-carbonitrile?
5-(1,2-difluoro-2-methylpropyl)cyclohexa-1,3-diene-1-carbonitrile has a molecular weight of 197.23 g/mol, XLogP of 3.10, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1,2-difluoro-2-methylpropyl)cyclohexa-1,3-diene-1-carbonitrile is sourced from PubChem (CID 70316371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).