C13H16BrFO2 — CID 70316429
ethyl (2R,3R)-3-(4-bromo-2-fluorophenyl)-2-methylbutanoate (PubChem CID 70316429) has the molecular formula C13H16BrFO2 and a molecular weight of 303.17 g/mol. Its IUPAC name is ethyl (2R,3R)-3-(4-bromo-2-fluorophenyl)-2-methylbutanoate.
| Compound Name | ethyl (2R,3R)-3-(4-bromo-2-fluorophenyl)-2-methylbutanoate |
|---|---|
| PubChem CID | 70316429 |
| Molecular Formula | C13H16BrFO2 |
| Molecular Weight | 303.17 g/mol |
| Exact Mass | 302.03 |
| IUPAC Name | ethyl (2R,3R)-3-(4-bromo-2-fluorophenyl)-2-methylbutanoate |
| SMILES | CCOC(=O)[C@H](C)[C@@H](C)c1ccc(Br)cc1F |
| InChI | InChI=1S/C13H16BrFO2/c1-4-17-13(16)9(3)8(2)11-6-5-10(14)7-12(11)15/h5-9H,4H2,1-3H3/t8-,9-/m1/s1 |
| InChIKey | TVTKMPLOKRWZGF-RKDXNWHRSA-N |
| XLogP | 3.89 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.17 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |