C28H33N3O — CID 70316535
3-[(8R)-7,8-dimethyl-2-[(2-pyridin-4-ylphenyl)methyl]-3,4,6,7,9,9a-hexahydro-1H-pyrido[1,2-a]pyrazin-8-yl]phenol (PubChem CID 70316535) has the molecular formula C28H33N3O and a molecular weight of 427.59 g/mol. Its IUPAC name is 3-[(8R)-7,8-dimethyl-2-[(2-pyridin-4-ylphenyl)methyl]-3,4,6,7,9,9a-hexahydro-1H-pyrido[1,2-a]pyrazin-8-yl]phenol.
| Compound Name | 3-[(8R)-7,8-dimethyl-2-[(2-pyridin-4-ylphenyl)methyl]-3,4,6,7,9,9a-hexahydro-1H-pyrido[1,2-a]pyrazin-8-yl]phenol |
|---|---|
| PubChem CID | 70316535 |
| Molecular Formula | C28H33N3O |
| Molecular Weight | 427.59 g/mol |
| Exact Mass | 427.26 |
| IUPAC Name | 3-[(8R)-7,8-dimethyl-2-[(2-pyridin-4-ylphenyl)methyl]-3,4,6,7,9,9a-hexahydro-1H-pyrido[1,2-a]pyrazin-8-yl]phenol |
| SMILES | CC1CN2CCN(Cc3ccccc3-c3ccncc3)CC2C[C@@]1(C)c1cccc(O)c1 |
| InChI | InChI=1S/C28H33N3O/c1-21-18-31-15-14-30(19-23-6-3-4-9-27(23)22-10-12-29-13-11-22)20-25(31)17-28(21,2)24-7-5-8-26(32)16-24/h3-13,16,21,25,32H,14-15,17-20H2,1-2H3/t21?,25?,28-/m1/s1 |
| InChIKey | DWEVEOSMWRZLRF-QREUFCTJSA-N |
| XLogP | 4.94 |
| TPSA | 39.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.59 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |