C14H16FNO4 — CID 70316673
benzyl (3R,3aR,6S)-6-fluoro-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-4-carboxylate (PubChem CID 70316673) has the molecular formula C14H16FNO4 and a molecular weight of 281.28 g/mol. Its IUPAC name is benzyl (3R,3aR,6S)-6-fluoro-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-4-carboxylate.
| Compound Name | benzyl (3R,3aR,6S)-6-fluoro-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-4-carboxylate |
|---|---|
| PubChem CID | 70316673 |
| Molecular Formula | C14H16FNO4 |
| Molecular Weight | 281.28 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | benzyl (3R,3aR,6S)-6-fluoro-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-4-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1C[C@H](F)C2OC[C@H](O)[C@H]21 |
| InChI | InChI=1S/C14H16FNO4/c15-10-6-16(12-11(17)8-19-13(10)12)14(18)20-7-9-4-2-1-3-5-9/h1-5,10-13,17H,6-8H2/t10-,11-,12+,13?/m0/s1 |
| InChIKey | QVYNRUYREGXGFF-ACJTYDJDSA-N |
| XLogP | 1.11 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.28 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |