About 3-thiophen-2-ylpropanoic acid
3-thiophen-2-ylpropanoic acid (PubChem CID 703169) has the molecular formula C7H8O2S
and a molecular weight of 156.21 g/mol. Its IUPAC name is 3-thiophen-2-ylpropanoic acid.
Molecular Properties
| Compound Name | 3-thiophen-2-ylpropanoic acid |
| PubChem CID | 703169 |
| Molecular Formula | C7H8O2S |
| Molecular Weight | 156.21 g/mol |
| Exact Mass | 156.02 |
| IUPAC Name | 3-thiophen-2-ylpropanoic acid |
| SMILES | O=C(O)CCc1cccs1 |
| InChI | InChI=1S/C7H8O2S/c8-7(9)4-3-6-2-1-5-10-6/h1-2,5H,3-4H2,(H,8,9) |
| InChIKey | MJPVYTKZYZPIQA-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.21 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-thiophen-2-ylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-thiophen-2-ylpropanoic acid?
The IUPAC name of 3-thiophen-2-ylpropanoic acid (CID 703169) is 3-thiophen-2-ylpropanoic acid.
What is the SMILES notation for 3-thiophen-2-ylpropanoic acid?
The canonical SMILES for 3-thiophen-2-ylpropanoic acid is O=C(O)CCc1cccs1.
What is the InChIKey of 3-thiophen-2-ylpropanoic acid?
The InChIKey is MJPVYTKZYZPIQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O2S/c8-7(9)4-3-6-2-1-5-10-6/h1-2,5H,3-4H2,(H,8,9).
What are the key properties of 3-thiophen-2-ylpropanoic acid?
3-thiophen-2-ylpropanoic acid has a molecular weight of 156.21 g/mol, XLogP of 1.77, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-thiophen-2-ylpropanoic acid is sourced from PubChem (CID 703169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).