About [5-bromo-4-(3-chloro-4-fluorophenyl)-1,3-thiazol-2-yl] hydrogen carbonate
[5-bromo-4-(3-chloro-4-fluorophenyl)-1,3-thiazol-2-yl] hydrogen carbonate (PubChem CID 70317007) has the molecular formula C10H4BrClFNO3S
and a molecular weight of 352.57 g/mol. Its IUPAC name is [5-bromo-4-(3-chloro-4-fluorophenyl)-1,3-thiazol-2-yl] hydrogen carbonate.
Molecular Properties
| Compound Name | [5-bromo-4-(3-chloro-4-fluorophenyl)-1,3-thiazol-2-yl] hydrogen carbonate |
| PubChem CID | 70317007 |
| Molecular Formula | C10H4BrClFNO3S |
| Molecular Weight | 352.57 g/mol |
| Exact Mass | 350.88 |
| IUPAC Name | [5-bromo-4-(3-chloro-4-fluorophenyl)-1,3-thiazol-2-yl] hydrogen carbonate |
| SMILES | O=C(O)Oc1nc(-c2ccc(F)c(Cl)c2)c(Br)s1 |
| InChI | InChI=1S/C10H4BrClFNO3S/c11-8-7(14-9(18-8)17-10(15)16)4-1-2-6(13)5(12)3-4/h1-3H,(H,15,16) |
| InChIKey | RNIMMVKOTNDRBY-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.57 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [5-bromo-4-(3-chloro-4-fluorophenyl)-1,3-thiazol-2-yl] hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-bromo-4-(3-chloro-4-fluorophenyl)-1,3-thiazol-2-yl] hydrogen carbonate?
The IUPAC name of [5-bromo-4-(3-chloro-4-fluorophenyl)-1,3-thiazol-2-yl] hydrogen carbonate (CID 70317007) is [5-bromo-4-(3-chloro-4-fluorophenyl)-1,3-thiazol-2-yl] hydrogen carbonate.
What is the SMILES notation for [5-bromo-4-(3-chloro-4-fluorophenyl)-1,3-thiazol-2-yl] hydrogen carbonate?
The canonical SMILES for [5-bromo-4-(3-chloro-4-fluorophenyl)-1,3-thiazol-2-yl] hydrogen carbonate is O=C(O)Oc1nc(-c2ccc(F)c(Cl)c2)c(Br)s1.
What is the InChIKey of [5-bromo-4-(3-chloro-4-fluorophenyl)-1,3-thiazol-2-yl] hydrogen carbonate?
The InChIKey is RNIMMVKOTNDRBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H4BrClFNO3S/c11-8-7(14-9(18-8)17-10(15)16)4-1-2-6(13)5(12)3-4/h1-3H,(H,15,16).
What are the key properties of [5-bromo-4-(3-chloro-4-fluorophenyl)-1,3-thiazol-2-yl] hydrogen carbonate?
[5-bromo-4-(3-chloro-4-fluorophenyl)-1,3-thiazol-2-yl] hydrogen carbonate has a molecular weight of 352.57 g/mol, XLogP of 4.42, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [5-bromo-4-(3-chloro-4-fluorophenyl)-1,3-thiazol-2-yl] hydrogen carbonate is sourced from PubChem (CID 70317007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).