About (4S)-3-(4-methylphenyl)-4-phenyl-4,5-dihydro-1H-pyrazole
(4S)-3-(4-methylphenyl)-4-phenyl-4,5-dihydro-1H-pyrazole (PubChem CID 70317013) has the molecular formula C16H16N2
and a molecular weight of 236.32 g/mol. Its IUPAC name is (4S)-3-(4-methylphenyl)-4-phenyl-4,5-dihydro-1H-pyrazole.
Molecular Properties
| Compound Name | (4S)-3-(4-methylphenyl)-4-phenyl-4,5-dihydro-1H-pyrazole |
| PubChem CID | 70317013 |
| Molecular Formula | C16H16N2 |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | (4S)-3-(4-methylphenyl)-4-phenyl-4,5-dihydro-1H-pyrazole |
| SMILES | Cc1ccc(C2=NNC[C@@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C16H16N2/c1-12-7-9-14(10-8-12)16-15(11-17-18-16)13-5-3-2-4-6-13/h2-10,15,17H,11H2,1H3/t15-/m1/s1 |
| InChIKey | PYHVIBROLPRANY-OAHLLOKOSA-N |
| XLogP | 3.09 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4S)-3-(4-methylphenyl)-4-phenyl-4,5-dihydro-1H-pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-3-(4-methylphenyl)-4-phenyl-4,5-dihydro-1H-pyrazole?
The IUPAC name of (4S)-3-(4-methylphenyl)-4-phenyl-4,5-dihydro-1H-pyrazole (CID 70317013) is (4S)-3-(4-methylphenyl)-4-phenyl-4,5-dihydro-1H-pyrazole.
What is the SMILES notation for (4S)-3-(4-methylphenyl)-4-phenyl-4,5-dihydro-1H-pyrazole?
The canonical SMILES for (4S)-3-(4-methylphenyl)-4-phenyl-4,5-dihydro-1H-pyrazole is Cc1ccc(C2=NNC[C@@H]2c2ccccc2)cc1.
What is the InChIKey of (4S)-3-(4-methylphenyl)-4-phenyl-4,5-dihydro-1H-pyrazole?
The InChIKey is PYHVIBROLPRANY-OAHLLOKOSA-N. The full InChI is InChI=1S/C16H16N2/c1-12-7-9-14(10-8-12)16-15(11-17-18-16)13-5-3-2-4-6-13/h2-10,15,17H,11H2,1H3/t15-/m1/s1.
What are the key properties of (4S)-3-(4-methylphenyl)-4-phenyl-4,5-dihydro-1H-pyrazole?
(4S)-3-(4-methylphenyl)-4-phenyl-4,5-dihydro-1H-pyrazole has a molecular weight of 236.32 g/mol, XLogP of 3.09, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-3-(4-methylphenyl)-4-phenyl-4,5-dihydro-1H-pyrazole is sourced from PubChem (CID 70317013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).