About methyl 4-[(5-chloro-2,3-dihydrothiophene-2-carbonyl)amino]-1,2-thiazole-3-carboxylate
methyl 4-[(5-chloro-2,3-dihydrothiophene-2-carbonyl)amino]-1,2-thiazole-3-carboxylate (PubChem CID 70317047) has the molecular formula C10H9ClN2O3S2
and a molecular weight of 304.78 g/mol. Its IUPAC name is methyl 4-[(5-chloro-2,3-dihydrothiophene-2-carbonyl)amino]-1,2-thiazole-3-carboxylate.
Molecular Properties
| Compound Name | methyl 4-[(5-chloro-2,3-dihydrothiophene-2-carbonyl)amino]-1,2-thiazole-3-carboxylate |
| PubChem CID | 70317047 |
| Molecular Formula | C10H9ClN2O3S2 |
| Molecular Weight | 304.78 g/mol |
| Exact Mass | 303.97 |
| IUPAC Name | methyl 4-[(5-chloro-2,3-dihydrothiophene-2-carbonyl)amino]-1,2-thiazole-3-carboxylate |
| SMILES | COC(=O)c1nscc1NC(=O)C1CC=C(Cl)S1 |
| InChI | InChI=1S/C10H9ClN2O3S2/c1-16-10(15)8-5(4-17-13-8)12-9(14)6-2-3-7(11)18-6/h3-4,6H,2H2,1H3,(H,12,14) |
| InChIKey | FWZJWYIOPSNECC-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.78 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 4-[(5-chloro-2,3-dihydrothiophene-2-carbonyl)amino]-1,2-thiazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[(5-chloro-2,3-dihydrothiophene-2-carbonyl)amino]-1,2-thiazole-3-carboxylate?
The IUPAC name of methyl 4-[(5-chloro-2,3-dihydrothiophene-2-carbonyl)amino]-1,2-thiazole-3-carboxylate (CID 70317047) is methyl 4-[(5-chloro-2,3-dihydrothiophene-2-carbonyl)amino]-1,2-thiazole-3-carboxylate.
What is the SMILES notation for methyl 4-[(5-chloro-2,3-dihydrothiophene-2-carbonyl)amino]-1,2-thiazole-3-carboxylate?
The canonical SMILES for methyl 4-[(5-chloro-2,3-dihydrothiophene-2-carbonyl)amino]-1,2-thiazole-3-carboxylate is COC(=O)c1nscc1NC(=O)C1CC=C(Cl)S1.
What is the InChIKey of methyl 4-[(5-chloro-2,3-dihydrothiophene-2-carbonyl)amino]-1,2-thiazole-3-carboxylate?
The InChIKey is FWZJWYIOPSNECC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9ClN2O3S2/c1-16-10(15)8-5(4-17-13-8)12-9(14)6-2-3-7(11)18-6/h3-4,6H,2H2,1H3,(H,12,14).
What are the key properties of methyl 4-[(5-chloro-2,3-dihydrothiophene-2-carbonyl)amino]-1,2-thiazole-3-carboxylate?
methyl 4-[(5-chloro-2,3-dihydrothiophene-2-carbonyl)amino]-1,2-thiazole-3-carboxylate has a molecular weight of 304.78 g/mol, XLogP of 2.45, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[(5-chloro-2,3-dihydrothiophene-2-carbonyl)amino]-1,2-thiazole-3-carboxylate is sourced from PubChem (CID 70317047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).