C23H33N5O3 — CID 70317303
7-(2-methoxy-2,3-dihydropyridin-5-yl)-3-(3-methylbutylamino)-1-(2-propoxyethyl)pyrido[2,3-b]pyrazin-2-one (PubChem CID 70317303) has the molecular formula C23H33N5O3 and a molecular weight of 427.55 g/mol. Its IUPAC name is 7-(2-methoxy-2,3-dihydropyridin-5-yl)-3-(3-methylbutylamino)-1-(2-propoxyethyl)pyrido[2,3-b]pyrazin-2-one.
| Compound Name | 7-(2-methoxy-2,3-dihydropyridin-5-yl)-3-(3-methylbutylamino)-1-(2-propoxyethyl)pyrido[2,3-b]pyrazin-2-one |
|---|---|
| PubChem CID | 70317303 |
| Molecular Formula | C23H33N5O3 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.26 |
| IUPAC Name | 7-(2-methoxy-2,3-dihydropyridin-5-yl)-3-(3-methylbutylamino)-1-(2-propoxyethyl)pyrido[2,3-b]pyrazin-2-one |
| SMILES | CCCOCCn1c(=O)c(NCCC(C)C)nc2ncc(C3=CCC(OC)N=C3)cc21 |
| InChI | InChI=1S/C23H33N5O3/c1-5-11-31-12-10-28-19-13-18(17-6-7-20(30-4)25-14-17)15-26-21(19)27-22(23(28)29)24-9-8-16(2)3/h6,13-16,20H,5,7-12H2,1-4H3,(H,24,26,27) |
| InChIKey | UUZVXAXEDDPINU-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 90.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|