About 1-[(1S,2R,4R)-7-oxabicyclo[2.2.1]heptan-2-yl]ethanone
1-[(1S,2R,4R)-7-oxabicyclo[2.2.1]heptan-2-yl]ethanone (PubChem CID 70317528) has the molecular formula C8H12O2
and a molecular weight of 140.18 g/mol. Its IUPAC name is 1-[(1S,2R,4R)-7-oxabicyclo[2.2.1]heptan-2-yl]ethanone.
Molecular Properties
| Compound Name | 1-[(1S,2R,4R)-7-oxabicyclo[2.2.1]heptan-2-yl]ethanone |
| PubChem CID | 70317528 |
| Molecular Formula | C8H12O2 |
| Molecular Weight | 140.18 g/mol |
| Exact Mass | 140.08 |
| IUPAC Name | 1-[(1S,2R,4R)-7-oxabicyclo[2.2.1]heptan-2-yl]ethanone |
| SMILES | CC(=O)[C@@H]1C[C@H]2CC[C@@H]1O2 |
| InChI | InChI=1S/C8H12O2/c1-5(9)7-4-6-2-3-8(7)10-6/h6-8H,2-4H2,1H3/t6-,7+,8+/m1/s1 |
| InChIKey | AJENGVZEIVIXKF-CSMHCCOUSA-N |
| XLogP | 1.14 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.18 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[(1S,2R,4R)-7-oxabicyclo[2.2.1]heptan-2-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1S,2R,4R)-7-oxabicyclo[2.2.1]heptan-2-yl]ethanone?
The IUPAC name of 1-[(1S,2R,4R)-7-oxabicyclo[2.2.1]heptan-2-yl]ethanone (CID 70317528) is 1-[(1S,2R,4R)-7-oxabicyclo[2.2.1]heptan-2-yl]ethanone.
What is the SMILES notation for 1-[(1S,2R,4R)-7-oxabicyclo[2.2.1]heptan-2-yl]ethanone?
The canonical SMILES for 1-[(1S,2R,4R)-7-oxabicyclo[2.2.1]heptan-2-yl]ethanone is CC(=O)[C@@H]1C[C@H]2CC[C@@H]1O2.
What is the InChIKey of 1-[(1S,2R,4R)-7-oxabicyclo[2.2.1]heptan-2-yl]ethanone?
The InChIKey is AJENGVZEIVIXKF-CSMHCCOUSA-N. The full InChI is InChI=1S/C8H12O2/c1-5(9)7-4-6-2-3-8(7)10-6/h6-8H,2-4H2,1H3/t6-,7+,8+/m1/s1.
What are the key properties of 1-[(1S,2R,4R)-7-oxabicyclo[2.2.1]heptan-2-yl]ethanone?
1-[(1S,2R,4R)-7-oxabicyclo[2.2.1]heptan-2-yl]ethanone has a molecular weight of 140.18 g/mol, XLogP of 1.14, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1S,2R,4R)-7-oxabicyclo[2.2.1]heptan-2-yl]ethanone is sourced from PubChem (CID 70317528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).