C26H40O4 — CID 70317633
[(1S,2R,5R)-2,5-dimethyl-3-[(Z,3R)-3-methyl-6-[(2R)-6-oxo-2,3-dihydropyran-2-yl]hex-1-enyl]cyclohex-3-en-1-yl] 2,2-dimethylbutanoate (PubChem CID 70317633) has the molecular formula C26H40O4 and a molecular weight of 416.60 g/mol. Its IUPAC name is [(1S,2R,5R)-2,5-dimethyl-3-[(Z,3R)-3-methyl-6-[(2R)-6-oxo-2,3-dihydropyran-2-yl]hex-1-enyl]cyclohex-3-en-1-yl] 2,2-dimethylbutanoate.
| Compound Name | [(1S,2R,5R)-2,5-dimethyl-3-[(Z,3R)-3-methyl-6-[(2R)-6-oxo-2,3-dihydropyran-2-yl]hex-1-enyl]cyclohex-3-en-1-yl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 70317633 |
| Molecular Formula | C26H40O4 |
| Molecular Weight | 416.60 g/mol |
| Exact Mass | 416.29 |
| IUPAC Name | [(1S,2R,5R)-2,5-dimethyl-3-[(Z,3R)-3-methyl-6-[(2R)-6-oxo-2,3-dihydropyran-2-yl]hex-1-enyl]cyclohex-3-en-1-yl] 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)O[C@H]1C[C@@H](C)C=C(/C=C\[C@H](C)CCC[C@@H]2CC=CC(=O)O2)[C@H]1C |
| InChI | InChI=1S/C26H40O4/c1-7-26(5,6)25(28)30-23-17-19(3)16-21(20(23)4)15-14-18(2)10-8-11-22-12-9-13-24(27)29-22/h9,13-16,18-20,22-23H,7-8,10-12,17H2,1-6H3/b15-14-/t18-,19+,20-,22-,23+/m1/s1 |
| InChIKey | RTIZHXRKACEIJO-KLTCCZHESA-N |
| XLogP | 6.17 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.60 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |