C21H35N5O5 — CID 70317804
(2S)-1-[(2S)-2-(carbamoylamino)-3,3-dimethylbutanoyl]-N-[1,2-dioxo-1-(prop-2-enylamino)hexan-3-yl]pyrrolidine-2-carboxamide (PubChem CID 70317804) has the molecular formula C21H35N5O5 and a molecular weight of 437.54 g/mol. Its IUPAC name is (2S)-1-[(2S)-2-(carbamoylamino)-3,3-dimethylbutanoyl]-N-[1,2-dioxo-1-(prop-2-enylamino)hexan-3-yl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-[(2S)-2-(carbamoylamino)-3,3-dimethylbutanoyl]-N-[1,2-dioxo-1-(prop-2-enylamino)hexan-3-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 70317804 |
| Molecular Formula | C21H35N5O5 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.26 |
| IUPAC Name | (2S)-1-[(2S)-2-(carbamoylamino)-3,3-dimethylbutanoyl]-N-[1,2-dioxo-1-(prop-2-enylamino)hexan-3-yl]pyrrolidine-2-carboxamide |
| SMILES | C=CCNC(=O)C(=O)C(CCC)NC(=O)[C@@H]1CCCN1C(=O)[C@@H](NC(N)=O)C(C)(C)C |
| InChI | InChI=1S/C21H35N5O5/c1-6-9-13(15(27)18(29)23-11-7-2)24-17(28)14-10-8-12-26(14)19(30)16(21(3,4)5)25-20(22)31/h7,13-14,16H,2,6,8-12H2,1,3-5H3,(H,23,29)(H,24,28)(H3,22,25,31)/t13?,14-,16+/m0/s1 |
| InChIKey | CBEYGQFZHDZYQG-JGKCFBKVSA-N |
| XLogP | 0.22 |
| TPSA | 150.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|