C22H30O9 — CID 70317962
(2S,12R)-2-tert-butyl-12-methoxy-13-[[(3R,4S)-3-methoxy-4-methyl-5-oxooxolan-2-yl]methyl]-5,8,10-trioxatetracyclo[5.5.1.01,9.04,13]tridecane-6,11-dione (PubChem CID 70317962) has the molecular formula C22H30O9 and a molecular weight of 438.47 g/mol. Its IUPAC name is (2S,12R)-2-tert-butyl-12-methoxy-13-[[(3R,4S)-3-methoxy-4-methyl-5-oxooxolan-2-yl]methyl]-5,8,10-trioxatetracyclo[5.5.1.01,9.04,13]tridecane-6,11-dione.
| Compound Name | (2S,12R)-2-tert-butyl-12-methoxy-13-[[(3R,4S)-3-methoxy-4-methyl-5-oxooxolan-2-yl]methyl]-5,8,10-trioxatetracyclo[5.5.1.01,9.04,13]tridecane-6,11-dione |
|---|---|
| PubChem CID | 70317962 |
| Molecular Formula | C22H30O9 |
| Molecular Weight | 438.47 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | (2S,12R)-2-tert-butyl-12-methoxy-13-[[(3R,4S)-3-methoxy-4-methyl-5-oxooxolan-2-yl]methyl]-5,8,10-trioxatetracyclo[5.5.1.01,9.04,13]tridecane-6,11-dione |
| SMILES | CO[C@H]1C(CC23C4CC(C(C)(C)C)C25C(OC(=O)[C@@H]5OC)OC3C(=O)O4)OC(=O)[C@H]1C |
| InChI | InChI=1S/C22H30O9/c1-9-13(26-5)10(28-16(9)23)8-21-12-7-11(20(2,3)4)22(21)15(27-6)18(25)31-19(22)30-14(21)17(24)29-12/h9-15,19H,7-8H2,1-6H3/t9-,10?,11?,12?,13+,14?,15-,19?,21?,22?/m0/s1 |
| InChIKey | XOLSBDGAPDSHIK-MDFHPPSHSA-N |
| XLogP | 1.21 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.47 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|