C28H27N7O4 — CID 70317967
prop-2-enyl (1S)-1-[[5-[(4-aminophenyl)methylcarbamoyl]-[1,2,4]triazolo[1,5-a]pyrimidine-7-carbonyl]amino]-4-methyl-2,3-dihydro-1H-indene-5-carboxylate (PubChem CID 70317967) has the molecular formula C28H27N7O4 and a molecular weight of 525.57 g/mol. Its IUPAC name is prop-2-enyl (1S)-1-[[5-[(4-aminophenyl)methylcarbamoyl]-[1,2,4]triazolo[1,5-a]pyrimidine-7-carbonyl]amino]-4-methyl-2,3-dihydro-1H-indene-5-carboxylate.
| Compound Name | prop-2-enyl (1S)-1-[[5-[(4-aminophenyl)methylcarbamoyl]-[1,2,4]triazolo[1,5-a]pyrimidine-7-carbonyl]amino]-4-methyl-2,3-dihydro-1H-indene-5-carboxylate |
|---|---|
| PubChem CID | 70317967 |
| Molecular Formula | C28H27N7O4 |
| Molecular Weight | 525.57 g/mol |
| Exact Mass | 525.21 |
| IUPAC Name | prop-2-enyl (1S)-1-[[5-[(4-aminophenyl)methylcarbamoyl]-[1,2,4]triazolo[1,5-a]pyrimidine-7-carbonyl]amino]-4-methyl-2,3-dihydro-1H-indene-5-carboxylate |
| SMILES | C=CCOC(=O)c1ccc2c(c1C)CC[C@@H]2NC(=O)c1cc(C(=O)NCc2ccc(N)cc2)nc2ncnn12 |
| InChI | InChI=1S/C28H27N7O4/c1-3-12-39-27(38)20-8-9-21-19(16(20)2)10-11-22(21)33-26(37)24-13-23(34-28-31-15-32-35(24)28)25(36)30-14-17-4-6-18(29)7-5-17/h3-9,13,15,22H,1,10-12,14,29H2,2H3,(H,30,36)(H,33,37)/t22-/m0/s1 |
| InChIKey | WWLBUYHPJYUDKE-QFIPXVFZSA-N |
| XLogP | 2.71 |
| TPSA | 153.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.57 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|