C22H24N2O7 — CID 70317968
methyl 4-[[(2-methoxy-2-oxoethyl)-[2-(phenylmethoxycarbonylamino)acetyl]amino]methyl]benzoate (PubChem CID 70317968) has the molecular formula C22H24N2O7 and a molecular weight of 428.44 g/mol. Its IUPAC name is methyl 4-[[(2-methoxy-2-oxoethyl)-[2-(phenylmethoxycarbonylamino)acetyl]amino]methyl]benzoate.
| Compound Name | methyl 4-[[(2-methoxy-2-oxoethyl)-[2-(phenylmethoxycarbonylamino)acetyl]amino]methyl]benzoate |
|---|---|
| PubChem CID | 70317968 |
| Molecular Formula | C22H24N2O7 |
| Molecular Weight | 428.44 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | methyl 4-[[(2-methoxy-2-oxoethyl)-[2-(phenylmethoxycarbonylamino)acetyl]amino]methyl]benzoate |
| SMILES | COC(=O)CN(Cc1ccc(C(=O)OC)cc1)C(=O)CNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C22H24N2O7/c1-29-20(26)14-24(13-16-8-10-18(11-9-16)21(27)30-2)19(25)12-23-22(28)31-15-17-6-4-3-5-7-17/h3-11H,12-15H2,1-2H3,(H,23,28) |
| InChIKey | NIQGCEWDBXKPDD-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.44 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|