C16H19NO4 — CID 70318801
1-[5-[(4-methylmorpholin-2-yl)methoxy]-1-benzofuran-2-yl]ethenol (PubChem CID 70318801) has the molecular formula C16H19NO4 and a molecular weight of 289.33 g/mol. Its IUPAC name is 1-[5-[(4-methylmorpholin-2-yl)methoxy]-1-benzofuran-2-yl]ethenol.
| Compound Name | 1-[5-[(4-methylmorpholin-2-yl)methoxy]-1-benzofuran-2-yl]ethenol |
|---|---|
| PubChem CID | 70318801 |
| Molecular Formula | C16H19NO4 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | 1-[5-[(4-methylmorpholin-2-yl)methoxy]-1-benzofuran-2-yl]ethenol |
| SMILES | C=C(O)c1cc2cc(OCC3CN(C)CCO3)ccc2o1 |
| InChI | InChI=1S/C16H19NO4/c1-11(18)16-8-12-7-13(3-4-15(12)21-16)20-10-14-9-17(2)5-6-19-14/h3-4,7-8,14,18H,1,5-6,9-10H2,2H3 |
| InChIKey | WSLIONZMDNSWPP-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 55.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|