C14H31N3OSi — CID 70318951
[4-[(3S)-2,3,4,6,7,8,9,9a-octahydro-1H-pyrazino[1,2-a]pyrazin-3-yl]-2-methylbutan-2-yl]-hydroxy-dimethylsilane (PubChem CID 70318951) has the molecular formula C14H31N3OSi and a molecular weight of 285.51 g/mol. Its IUPAC name is [4-[(3S)-2,3,4,6,7,8,9,9a-octahydro-1H-pyrazino[1,2-a]pyrazin-3-yl]-2-methylbutan-2-yl]-hydroxy-dimethylsilane.
| Compound Name | [4-[(3S)-2,3,4,6,7,8,9,9a-octahydro-1H-pyrazino[1,2-a]pyrazin-3-yl]-2-methylbutan-2-yl]-hydroxy-dimethylsilane |
|---|---|
| PubChem CID | 70318951 |
| Molecular Formula | C14H31N3OSi |
| Molecular Weight | 285.51 g/mol |
| Exact Mass | 285.22 |
| IUPAC Name | [4-[(3S)-2,3,4,6,7,8,9,9a-octahydro-1H-pyrazino[1,2-a]pyrazin-3-yl]-2-methylbutan-2-yl]-hydroxy-dimethylsilane |
| SMILES | CC(C)(CC[C@H]1CN2CCNCC2CN1)[Si](C)(C)O |
| InChI | InChI=1S/C14H31N3OSi/c1-14(2,19(3,4)18)6-5-12-11-17-8-7-15-9-13(17)10-16-12/h12-13,15-16,18H,5-11H2,1-4H3/t12-,13?/m0/s1 |
| InChIKey | JCGMZMQLDQXKJC-UEWDXFNNSA-N |
| XLogP | 0.99 |
| TPSA | 47.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.51 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|