About 2-methylpropyl N-[2-[(2S)-4,4-difluoro-2-(methoxymethyl)pyrrolidin-1-yl]-2-oxoethyl]carbamate
2-methylpropyl N-[2-[(2S)-4,4-difluoro-2-(methoxymethyl)pyrrolidin-1-yl]-2-oxoethyl]carbamate (PubChem CID 70318979) has the molecular formula C13H22F2N2O4
and a molecular weight of 308.33 g/mol. Its IUPAC name is 2-methylpropyl N-[2-[(2S)-4,4-difluoro-2-(methoxymethyl)pyrrolidin-1-yl]-2-oxoethyl]carbamate.
Molecular Properties
| Compound Name | 2-methylpropyl N-[2-[(2S)-4,4-difluoro-2-(methoxymethyl)pyrrolidin-1-yl]-2-oxoethyl]carbamate |
| PubChem CID | 70318979 |
| Molecular Formula | C13H22F2N2O4 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | 2-methylpropyl N-[2-[(2S)-4,4-difluoro-2-(methoxymethyl)pyrrolidin-1-yl]-2-oxoethyl]carbamate |
| SMILES | COC[C@@H]1CC(F)(F)CN1C(=O)CNC(=O)OCC(C)C |
| InChI | InChI=1S/C13H22F2N2O4/c1-9(2)6-21-12(19)16-5-11(18)17-8-13(14,15)4-10(17)7-20-3/h9-10H,4-8H2,1-3H3,(H,16,19)/t10-/m0/s1 |
| InChIKey | GALUIRUAPTVFRL-JTQLQIEISA-N |
| XLogP | 1.25 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methylpropyl N-[2-[(2S)-4,4-difluoro-2-(methoxymethyl)pyrrolidin-1-yl]-2-oxoethyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropyl N-[2-[(2S)-4,4-difluoro-2-(methoxymethyl)pyrrolidin-1-yl]-2-oxoethyl]carbamate?
The IUPAC name of 2-methylpropyl N-[2-[(2S)-4,4-difluoro-2-(methoxymethyl)pyrrolidin-1-yl]-2-oxoethyl]carbamate (CID 70318979) is 2-methylpropyl N-[2-[(2S)-4,4-difluoro-2-(methoxymethyl)pyrrolidin-1-yl]-2-oxoethyl]carbamate.
What is the SMILES notation for 2-methylpropyl N-[2-[(2S)-4,4-difluoro-2-(methoxymethyl)pyrrolidin-1-yl]-2-oxoethyl]carbamate?
The canonical SMILES for 2-methylpropyl N-[2-[(2S)-4,4-difluoro-2-(methoxymethyl)pyrrolidin-1-yl]-2-oxoethyl]carbamate is COC[C@@H]1CC(F)(F)CN1C(=O)CNC(=O)OCC(C)C.
What is the InChIKey of 2-methylpropyl N-[2-[(2S)-4,4-difluoro-2-(methoxymethyl)pyrrolidin-1-yl]-2-oxoethyl]carbamate?
The InChIKey is GALUIRUAPTVFRL-JTQLQIEISA-N. The full InChI is InChI=1S/C13H22F2N2O4/c1-9(2)6-21-12(19)16-5-11(18)17-8-13(14,15)4-10(17)7-20-3/h9-10H,4-8H2,1-3H3,(H,16,19)/t10-/m0/s1.
What are the key properties of 2-methylpropyl N-[2-[(2S)-4,4-difluoro-2-(methoxymethyl)pyrrolidin-1-yl]-2-oxoethyl]carbamate?
2-methylpropyl N-[2-[(2S)-4,4-difluoro-2-(methoxymethyl)pyrrolidin-1-yl]-2-oxoethyl]carbamate has a molecular weight of 308.33 g/mol, XLogP of 1.25, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropyl N-[2-[(2S)-4,4-difluoro-2-(methoxymethyl)pyrrolidin-1-yl]-2-oxoethyl]carbamate is sourced from PubChem (CID 70318979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).