C21H28O7 — CID 70319097
[(4S,13S)-4-tert-butyl-13-methyl-7,14-dioxo-8,10,15-trioxapentacyclo[9.6.0.01,5.05,9.012,16]heptadecan-2-yl] acetate (PubChem CID 70319097) has the molecular formula C21H28O7 and a molecular weight of 392.45 g/mol. Its IUPAC name is [(4S,13S)-4-tert-butyl-13-methyl-7,14-dioxo-8,10,15-trioxapentacyclo[9.6.0.01,5.05,9.012,16]heptadecan-2-yl] acetate.
| Compound Name | [(4S,13S)-4-tert-butyl-13-methyl-7,14-dioxo-8,10,15-trioxapentacyclo[9.6.0.01,5.05,9.012,16]heptadecan-2-yl] acetate |
|---|---|
| PubChem CID | 70319097 |
| Molecular Formula | C21H28O7 |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | [(4S,13S)-4-tert-butyl-13-methyl-7,14-dioxo-8,10,15-trioxapentacyclo[9.6.0.01,5.05,9.012,16]heptadecan-2-yl] acetate |
| SMILES | CC(=O)OC1C[C@@H](C(C)(C)C)C23CC(=O)OC2OC2C4C(CC123)OC(=O)C4C |
| InChI | InChI=1S/C21H28O7/c1-9-15-11(26-17(9)24)7-21-13(25-10(2)22)6-12(19(3,4)5)20(21)8-14(23)27-18(20)28-16(15)21/h9,11-13,15-16,18H,6-8H2,1-5H3/t9?,11?,12-,13?,15?,16?,18?,20?,21?/m0/s1 |
| InChIKey | LWGIHFOSBPIGEF-RRDBAGQESA-N |
| XLogP | 2.21 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|