C17H28N4O4 — CID 70319230
(2S)-1-[(2S)-2-amino-3,3-dimethylbutanoyl]-N-[2,3-dioxo-3-(prop-2-enylamino)propyl]pyrrolidine-2-carboxamide (PubChem CID 70319230) has the molecular formula C17H28N4O4 and a molecular weight of 352.44 g/mol. Its IUPAC name is (2S)-1-[(2S)-2-amino-3,3-dimethylbutanoyl]-N-[2,3-dioxo-3-(prop-2-enylamino)propyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-[(2S)-2-amino-3,3-dimethylbutanoyl]-N-[2,3-dioxo-3-(prop-2-enylamino)propyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 70319230 |
| Molecular Formula | C17H28N4O4 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.21 |
| IUPAC Name | (2S)-1-[(2S)-2-amino-3,3-dimethylbutanoyl]-N-[2,3-dioxo-3-(prop-2-enylamino)propyl]pyrrolidine-2-carboxamide |
| SMILES | C=CCNC(=O)C(=O)CNC(=O)[C@@H]1CCCN1C(=O)[C@@H](N)C(C)(C)C |
| InChI | InChI=1S/C17H28N4O4/c1-5-8-19-15(24)12(22)10-20-14(23)11-7-6-9-21(11)16(25)13(18)17(2,3)4/h5,11,13H,1,6-10,18H2,2-4H3,(H,19,24)(H,20,23)/t11-,13+/m0/s1 |
| InChIKey | ZFJGEHMZEOXFIK-WCQYABFASA-N |
| XLogP | -0.66 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|