C21H26ClN5O2 — CID 70319389
2-[[6-(chloromethyl)-2-(2-morpholin-4-ylethylamino)benzimidazol-1-yl]methyl]-6-methylpyridin-3-ol (PubChem CID 70319389) has the molecular formula C21H26ClN5O2 and a molecular weight of 415.93 g/mol. Its IUPAC name is 2-[[6-(chloromethyl)-2-(2-morpholin-4-ylethylamino)benzimidazol-1-yl]methyl]-6-methylpyridin-3-ol.
| Compound Name | 2-[[6-(chloromethyl)-2-(2-morpholin-4-ylethylamino)benzimidazol-1-yl]methyl]-6-methylpyridin-3-ol |
|---|---|
| PubChem CID | 70319389 |
| Molecular Formula | C21H26ClN5O2 |
| Molecular Weight | 415.93 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | 2-[[6-(chloromethyl)-2-(2-morpholin-4-ylethylamino)benzimidazol-1-yl]methyl]-6-methylpyridin-3-ol |
| SMILES | Cc1ccc(O)c(Cn2c(NCCN3CCOCC3)nc3ccc(CCl)cc32)n1 |
| InChI | InChI=1S/C21H26ClN5O2/c1-15-2-5-20(28)18(24-15)14-27-19-12-16(13-22)3-4-17(19)25-21(27)23-6-7-26-8-10-29-11-9-26/h2-5,12,28H,6-11,13-14H2,1H3,(H,23,25) |
| InChIKey | HMSUVOQGMAPECW-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.93 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|