C27H32F3N7O4 — CID 70319430
tert-butyl 2-[[2-(diethylamino)-5-(2,2,2-trifluoroethyl)pyrimidin-4-yl]amino]-2-[4-[(3-nitro-2-pyridinyl)amino]phenyl]acetate (PubChem CID 70319430) has the molecular formula C27H32F3N7O4 and a molecular weight of 575.59 g/mol. Its IUPAC name is tert-butyl 2-[[2-(diethylamino)-5-(2,2,2-trifluoroethyl)pyrimidin-4-yl]amino]-2-[4-[(3-nitro-2-pyridinyl)amino]phenyl]acetate.
| Compound Name | tert-butyl 2-[[2-(diethylamino)-5-(2,2,2-trifluoroethyl)pyrimidin-4-yl]amino]-2-[4-[(3-nitro-2-pyridinyl)amino]phenyl]acetate |
|---|---|
| PubChem CID | 70319430 |
| Molecular Formula | C27H32F3N7O4 |
| Molecular Weight | 575.59 g/mol |
| Exact Mass | 575.25 |
| IUPAC Name | tert-butyl 2-[[2-(diethylamino)-5-(2,2,2-trifluoroethyl)pyrimidin-4-yl]amino]-2-[4-[(3-nitro-2-pyridinyl)amino]phenyl]acetate |
| SMILES | CCN(CC)c1ncc(CC(F)(F)F)c(NC(C(=O)OC(C)(C)C)c2ccc(Nc3ncccc3[N+](=O)[O-])cc2)n1 |
| InChI | InChI=1S/C27H32F3N7O4/c1-6-36(7-2)25-32-16-18(15-27(28,29)30)22(35-25)34-21(24(38)41-26(3,4)5)17-10-12-19(13-11-17)33-23-20(37(39)40)9-8-14-31-23/h8-14,16,21H,6-7,15H2,1-5H3,(H,31,33)(H,32,34,35) |
| InChIKey | DNOYLUGRVFLMKK-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 135.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.59 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|