C27H24N6O — CID 70319863
5-anilino-8-methyl-4-[(4-phenylphenyl)methyl]-1,3,4,8,10-pentazatricyclo[7.3.0.02,6]dodeca-2,5,9-trien-7-one (PubChem CID 70319863) has the molecular formula C27H24N6O and a molecular weight of 448.53 g/mol. Its IUPAC name is 5-anilino-8-methyl-4-[(4-phenylphenyl)methyl]-1,3,4,8,10-pentazatricyclo[7.3.0.02,6]dodeca-2,5,9-trien-7-one.
| Compound Name | 5-anilino-8-methyl-4-[(4-phenylphenyl)methyl]-1,3,4,8,10-pentazatricyclo[7.3.0.02,6]dodeca-2,5,9-trien-7-one |
|---|---|
| PubChem CID | 70319863 |
| Molecular Formula | C27H24N6O |
| Molecular Weight | 448.53 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | 5-anilino-8-methyl-4-[(4-phenylphenyl)methyl]-1,3,4,8,10-pentazatricyclo[7.3.0.02,6]dodeca-2,5,9-trien-7-one |
| SMILES | CN1C(=O)c2c(nn(Cc3ccc(-c4ccccc4)cc3)c2Nc2ccccc2)N2CCN=C12 |
| InChI | InChI=1S/C27H24N6O/c1-31-26(34)23-24(29-22-10-6-3-7-11-22)33(30-25(23)32-17-16-28-27(31)32)18-19-12-14-21(15-13-19)20-8-4-2-5-9-20/h2-15,29H,16-18H2,1H3 |
| InChIKey | SUVCLVCXFMHKIC-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 65.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.53 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |