C10H17NO — CID 7032041
(2S,6S)-4-ethynyl-1,2,6-trimethylpiperidin-4-ol (PubChem CID 7032041) has the molecular formula C10H17NO and a molecular weight of 167.25 g/mol. Its IUPAC name is (2S,6S)-4-ethynyl-1,2,6-trimethylpiperidin-4-ol.
| Compound Name | (2S,6S)-4-ethynyl-1,2,6-trimethylpiperidin-4-ol |
|---|---|
| PubChem CID | 7032041 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | (2S,6S)-4-ethynyl-1,2,6-trimethylpiperidin-4-ol |
| SMILES | C#CC1(O)C[C@H](C)N(C)[C@@H](C)C1 |
| InChI | InChI=1S/C10H17NO/c1-5-10(12)6-8(2)11(4)9(3)7-10/h1,8-9,12H,6-7H2,2-4H3/t8-,9-/m0/s1 |
| InChIKey | RPYVIDQHSNAQAX-IUCAKERBSA-N |
| XLogP | 0.85 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|