C21H20FN7O3S — CID 70320605
7-N-[(5-carbamoyl-2,3-dihydrothiophen-2-yl)methyl]-5-N-[(4-fluoro-3-methylphenyl)methyl]-[1,2,4]triazolo[1,5-a]pyrimidine-5,7-dicarboxamide (PubChem CID 70320605) has the molecular formula C21H20FN7O3S and a molecular weight of 469.50 g/mol. Its IUPAC name is 7-N-[(5-carbamoyl-2,3-dihydrothiophen-2-yl)methyl]-5-N-[(4-fluoro-3-methylphenyl)methyl]-[1,2,4]triazolo[1,5-a]pyrimidine-5,7-dicarboxamide.
| Compound Name | 7-N-[(5-carbamoyl-2,3-dihydrothiophen-2-yl)methyl]-5-N-[(4-fluoro-3-methylphenyl)methyl]-[1,2,4]triazolo[1,5-a]pyrimidine-5,7-dicarboxamide |
|---|---|
| PubChem CID | 70320605 |
| Molecular Formula | C21H20FN7O3S |
| Molecular Weight | 469.50 g/mol |
| Exact Mass | 469.13 |
| IUPAC Name | 7-N-[(5-carbamoyl-2,3-dihydrothiophen-2-yl)methyl]-5-N-[(4-fluoro-3-methylphenyl)methyl]-[1,2,4]triazolo[1,5-a]pyrimidine-5,7-dicarboxamide |
| SMILES | Cc1cc(CNC(=O)c2cc(C(=O)NCC3CC=C(C(N)=O)S3)n3ncnc3n2)ccc1F |
| InChI | InChI=1S/C21H20FN7O3S/c1-11-6-12(2-4-14(11)22)8-24-19(31)15-7-16(29-21(28-15)26-10-27-29)20(32)25-9-13-3-5-17(33-13)18(23)30/h2,4-7,10,13H,3,8-9H2,1H3,(H2,23,30)(H,24,31)(H,25,32) |
| InChIKey | CCRAAUJCIPOFGU-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 144.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.50 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |