C29H36N4O2 — CID 70320702
1-methyl-N-[(1S,2R)-2-[[(3S)-5-methyl-1-(4-methylphenyl)pyrrolidin-3-yl]carbamoyl]cyclohexyl]indole-2-carboxamide (PubChem CID 70320702) has the molecular formula C29H36N4O2 and a molecular weight of 472.63 g/mol. Its IUPAC name is 1-methyl-N-[(1S,2R)-2-[[(3S)-5-methyl-1-(4-methylphenyl)pyrrolidin-3-yl]carbamoyl]cyclohexyl]indole-2-carboxamide.
| Compound Name | 1-methyl-N-[(1S,2R)-2-[[(3S)-5-methyl-1-(4-methylphenyl)pyrrolidin-3-yl]carbamoyl]cyclohexyl]indole-2-carboxamide |
|---|---|
| PubChem CID | 70320702 |
| Molecular Formula | C29H36N4O2 |
| Molecular Weight | 472.63 g/mol |
| Exact Mass | 472.28 |
| IUPAC Name | 1-methyl-N-[(1S,2R)-2-[[(3S)-5-methyl-1-(4-methylphenyl)pyrrolidin-3-yl]carbamoyl]cyclohexyl]indole-2-carboxamide |
| SMILES | Cc1ccc(N2C[C@@H](NC(=O)[C@@H]3CCCC[C@@H]3NC(=O)c3cc4ccccc4n3C)CC2C)cc1 |
| InChI | InChI=1S/C29H36N4O2/c1-19-12-14-23(15-13-19)33-18-22(16-20(33)2)30-28(34)24-9-5-6-10-25(24)31-29(35)27-17-21-8-4-7-11-26(21)32(27)3/h4,7-8,11-15,17,20,22,24-25H,5-6,9-10,16,18H2,1-3H3,(H,30,34)(H,31,35)/t20?,22-,24+,25-/m0/s1 |
| InChIKey | CZAXIBFWUPQRKG-UMDLYYTKSA-N |
| XLogP | 4.56 |
| TPSA | 66.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.63 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|