C28H39N5O3 — CID 70320737
tert-butyl 4-[[1-[(3-butoxy-6-methyl-2-pyridinyl)methyl]benzimidazol-2-yl]amino]piperidine-1-carboxylate (PubChem CID 70320737) has the molecular formula C28H39N5O3 and a molecular weight of 493.65 g/mol. Its IUPAC name is tert-butyl 4-[[1-[(3-butoxy-6-methyl-2-pyridinyl)methyl]benzimidazol-2-yl]amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[1-[(3-butoxy-6-methyl-2-pyridinyl)methyl]benzimidazol-2-yl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 70320737 |
| Molecular Formula | C28H39N5O3 |
| Molecular Weight | 493.65 g/mol |
| Exact Mass | 493.31 |
| IUPAC Name | tert-butyl 4-[[1-[(3-butoxy-6-methyl-2-pyridinyl)methyl]benzimidazol-2-yl]amino]piperidine-1-carboxylate |
| SMILES | CCCCOc1ccc(C)nc1Cn1c(NC2CCN(C(=O)OC(C)(C)C)CC2)nc2ccccc21 |
| InChI | InChI=1S/C28H39N5O3/c1-6-7-18-35-25-13-12-20(2)29-23(25)19-33-24-11-9-8-10-22(24)31-26(33)30-21-14-16-32(17-15-21)27(34)36-28(3,4)5/h8-13,21H,6-7,14-19H2,1-5H3,(H,30,31) |
| InChIKey | NHHUAEYCBIUWON-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.65 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|