C14H22INO3 — CID 70320762
(3S,7R)-6-(2-butoxyethyl)-7-ethenyl-3-iodo-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-one (PubChem CID 70320762) has the molecular formula C14H22INO3 and a molecular weight of 379.24 g/mol. Its IUPAC name is (3S,7R)-6-(2-butoxyethyl)-7-ethenyl-3-iodo-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-one.
| Compound Name | (3S,7R)-6-(2-butoxyethyl)-7-ethenyl-3-iodo-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-one |
|---|---|
| PubChem CID | 70320762 |
| Molecular Formula | C14H22INO3 |
| Molecular Weight | 379.24 g/mol |
| Exact Mass | 379.06 |
| IUPAC Name | (3S,7R)-6-(2-butoxyethyl)-7-ethenyl-3-iodo-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-one |
| SMILES | C=C[C@@H]1C(CCOCCCC)C(=O)N2C1CO[C@H]2I |
| InChI | InChI=1S/C14H22INO3/c1-3-5-7-18-8-6-11-10(4-2)12-9-19-14(15)16(12)13(11)17/h4,10-12,14H,2-3,5-9H2,1H3/t10-,11?,12?,14+/m1/s1 |
| InChIKey | HKGJPYKRRHITNS-NPZBDFSRSA-N |
| XLogP | 2.57 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.24 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|