C21H21N5O5 — CID 70321056
2-(aminomethylideneamino)-6-[[(1S)-4-methyl-5-prop-2-enoxycarbonyl-2,3-dihydro-1H-inden-1-yl]carbamoyl]pyrimidine-4-carboxylic acid (PubChem CID 70321056) has the molecular formula C21H21N5O5 and a molecular weight of 423.43 g/mol. Its IUPAC name is 2-(aminomethylideneamino)-6-[[(1S)-4-methyl-5-prop-2-enoxycarbonyl-2,3-dihydro-1H-inden-1-yl]carbamoyl]pyrimidine-4-carboxylic acid.
| Compound Name | 2-(aminomethylideneamino)-6-[[(1S)-4-methyl-5-prop-2-enoxycarbonyl-2,3-dihydro-1H-inden-1-yl]carbamoyl]pyrimidine-4-carboxylic acid |
|---|---|
| PubChem CID | 70321056 |
| Molecular Formula | C21H21N5O5 |
| Molecular Weight | 423.43 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | 2-(aminomethylideneamino)-6-[[(1S)-4-methyl-5-prop-2-enoxycarbonyl-2,3-dihydro-1H-inden-1-yl]carbamoyl]pyrimidine-4-carboxylic acid |
| SMILES | C=CCOC(=O)c1ccc2c(c1C)CC[C@@H]2NC(=O)c1cc(C(=O)O)nc(N=CN)n1 |
| InChI | InChI=1S/C21H21N5O5/c1-3-8-31-20(30)13-4-5-14-12(11(13)2)6-7-15(14)24-18(27)16-9-17(19(28)29)26-21(25-16)23-10-22/h3-5,9-10,15H,1,6-8H2,2H3,(H,24,27)(H,28,29)(H2,22,23,25,26)/t15-/m0/s1 |
| InChIKey | HMAVKOYYLYOMDN-HNNXBMFYSA-N |
| XLogP | 1.86 |
| TPSA | 156.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.43 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|