C26H30FN7O3 — CID 70321489
3-[3-[(6-fluoro-2-pyridinyl)amino]propylamino]-7-(6-methoxy-3-pyridinyl)-1-(2-propoxyethyl)pyrido[2,3-b]pyrazin-2-one (PubChem CID 70321489) has the molecular formula C26H30FN7O3 and a molecular weight of 507.57 g/mol. Its IUPAC name is 3-[3-[(6-fluoro-2-pyridinyl)amino]propylamino]-7-(6-methoxy-3-pyridinyl)-1-(2-propoxyethyl)pyrido[2,3-b]pyrazin-2-one.
| Compound Name | 3-[3-[(6-fluoro-2-pyridinyl)amino]propylamino]-7-(6-methoxy-3-pyridinyl)-1-(2-propoxyethyl)pyrido[2,3-b]pyrazin-2-one |
|---|---|
| PubChem CID | 70321489 |
| Molecular Formula | C26H30FN7O3 |
| Molecular Weight | 507.57 g/mol |
| Exact Mass | 507.24 |
| IUPAC Name | 3-[3-[(6-fluoro-2-pyridinyl)amino]propylamino]-7-(6-methoxy-3-pyridinyl)-1-(2-propoxyethyl)pyrido[2,3-b]pyrazin-2-one |
| SMILES | CCCOCCn1c(=O)c(NCCCNc2cccc(F)n2)nc2ncc(-c3ccc(OC)nc3)cc21 |
| InChI | InChI=1S/C26H30FN7O3/c1-3-13-37-14-12-34-20-15-19(18-8-9-23(36-2)30-16-18)17-31-24(20)33-25(26(34)35)29-11-5-10-28-22-7-4-6-21(27)32-22/h4,6-9,15-17H,3,5,10-14H2,1-2H3,(H,28,32)(H,29,31,33) |
| InChIKey | LFKVBJJZGUXHBC-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 116.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.57 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|