C30H37N7O — CID 70321587
13-(1-aminoethenyl)-2-[2-[2-(2-cyanopyrrolidin-1-yl)prop-2-enylamino]ethyl]-2-(N'-methylcarbamimidoyl)tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene-6-carboxamide (PubChem CID 70321587) has the molecular formula C30H37N7O and a molecular weight of 511.67 g/mol. Its IUPAC name is 13-(1-aminoethenyl)-2-[2-[2-(2-cyanopyrrolidin-1-yl)prop-2-enylamino]ethyl]-2-(N'-methylcarbamimidoyl)tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene-6-carboxamide.
| Compound Name | 13-(1-aminoethenyl)-2-[2-[2-(2-cyanopyrrolidin-1-yl)prop-2-enylamino]ethyl]-2-(N'-methylcarbamimidoyl)tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene-6-carboxamide |
|---|---|
| PubChem CID | 70321587 |
| Molecular Formula | C30H37N7O |
| Molecular Weight | 511.67 g/mol |
| Exact Mass | 511.31 |
| IUPAC Name | 13-(1-aminoethenyl)-2-[2-[2-(2-cyanopyrrolidin-1-yl)prop-2-enylamino]ethyl]-2-(N'-methylcarbamimidoyl)tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene-6-carboxamide |
| SMILES | C=C(N)c1ccc2c(c1)CCc1cc(C(N)=O)ccc1C2(CCNCC(=C)N1CCCC1C#N)/C(N)=N/C |
| InChI | InChI=1S/C30H37N7O/c1-19(37-14-4-5-25(37)17-31)18-36-13-12-30(29(34)35-3)26-10-8-21(20(2)32)15-22(26)6-7-23-16-24(28(33)38)9-11-27(23)30/h8-11,15-16,25,36H,1-2,4-7,12-14,18,32H2,3H3,(H2,33,38)(H2,34,35) |
| InChIKey | GNIVNTGIKMQBIN-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 146.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.67 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|