C34H45N5O7 — CID 70321606
(1R)-1-[[(2S)-1-[2-[[1-cyclobutyl-2-(1,3-dioxoisoindol-2-yl)ethyl]carbamoylamino]acetyl]pyrrolidine-2-carbonyl]amino]-2-[(Z)-oct-1-enyl]cyclopropane-1-carboxylic acid (PubChem CID 70321606) has the molecular formula C34H45N5O7 and a molecular weight of 635.76 g/mol. Its IUPAC name is (1R)-1-[[(2S)-1-[2-[[1-cyclobutyl-2-(1,3-dioxoisoindol-2-yl)ethyl]carbamoylamino]acetyl]pyrrolidine-2-carbonyl]amino]-2-[(Z)-oct-1-enyl]cyclopropane-1-carboxylic acid.
| Compound Name | (1R)-1-[[(2S)-1-[2-[[1-cyclobutyl-2-(1,3-dioxoisoindol-2-yl)ethyl]carbamoylamino]acetyl]pyrrolidine-2-carbonyl]amino]-2-[(Z)-oct-1-enyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 70321606 |
| Molecular Formula | C34H45N5O7 |
| Molecular Weight | 635.76 g/mol |
| Exact Mass | 635.33 |
| IUPAC Name | (1R)-1-[[(2S)-1-[2-[[1-cyclobutyl-2-(1,3-dioxoisoindol-2-yl)ethyl]carbamoylamino]acetyl]pyrrolidine-2-carbonyl]amino]-2-[(Z)-oct-1-enyl]cyclopropane-1-carboxylic acid |
| SMILES | CCCCCC/C=C\C1C[C@]1(NC(=O)[C@@H]1CCCN1C(=O)CNC(=O)NC(CN1C(=O)c2ccccc2C1=O)C1CCC1)C(=O)O |
| InChI | InChI=1S/C34H45N5O7/c1-2-3-4-5-6-7-14-23-19-34(23,32(44)45)37-29(41)27-17-11-18-38(27)28(40)20-35-33(46)36-26(22-12-10-13-22)21-39-30(42)24-15-8-9-16-25(24)31(39)43/h7-9,14-16,22-23,26-27H,2-6,10-13,17-21H2,1H3,(H,37,41)(H,44,45)(H2,35,36,46)/b14-7-/t23?,26?,27-,34+/m0/s1 |
| InChIKey | XYKXCONCNUPEPD-VCRFIUGKSA-N |
| XLogP | 3.23 |
| TPSA | 165.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.76 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|