C29H33N9O3 — CID 70321942
2-[2-[[2-[(3S)-5-cyano-2,3-dimethylpyrrolidin-1-yl]-2-oxoethyl]amino]ethyl]-2-(2H-tetrazol-5-yl)tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene-6,13-dicarboxamide (PubChem CID 70321942) has the molecular formula C29H33N9O3 and a molecular weight of 555.64 g/mol. Its IUPAC name is 2-[2-[[2-[(3S)-5-cyano-2,3-dimethylpyrrolidin-1-yl]-2-oxoethyl]amino]ethyl]-2-(2H-tetrazol-5-yl)tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene-6,13-dicarboxamide.
| Compound Name | 2-[2-[[2-[(3S)-5-cyano-2,3-dimethylpyrrolidin-1-yl]-2-oxoethyl]amino]ethyl]-2-(2H-tetrazol-5-yl)tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene-6,13-dicarboxamide |
|---|---|
| PubChem CID | 70321942 |
| Molecular Formula | C29H33N9O3 |
| Molecular Weight | 555.64 g/mol |
| Exact Mass | 555.27 |
| IUPAC Name | 2-[2-[[2-[(3S)-5-cyano-2,3-dimethylpyrrolidin-1-yl]-2-oxoethyl]amino]ethyl]-2-(2H-tetrazol-5-yl)tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene-6,13-dicarboxamide |
| SMILES | CC1[C@@H](C)CC(C#N)N1C(=O)CNCCC1(c2nn[nH]n2)c2ccc(C(N)=O)cc2CCc2cc(C(N)=O)ccc21 |
| InChI | InChI=1S/C29H33N9O3/c1-16-11-22(14-30)38(17(16)2)25(39)15-33-10-9-29(28-34-36-37-35-28)23-7-5-20(26(31)40)12-18(23)3-4-19-13-21(27(32)41)6-8-24(19)29/h5-8,12-13,16-17,22,33H,3-4,9-11,15H2,1-2H3,(H2,31,40)(H2,32,41)(H,34,35,36,37)/t16-,17?,22?/m0/s1 |
| InChIKey | OLIIBBQMBKXMNA-YPHUNTSASA-N |
| XLogP | 0.96 |
| TPSA | 196.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.64 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|