About 1-methyl-2,3-dihydro-1H-indene-5-carboxamide
1-methyl-2,3-dihydro-1H-indene-5-carboxamide (PubChem CID 70321993) has the molecular formula C11H13NO
and a molecular weight of 175.23 g/mol. Its IUPAC name is 1-methyl-2,3-dihydro-1H-indene-5-carboxamide.
Molecular Properties
| Compound Name | 1-methyl-2,3-dihydro-1H-indene-5-carboxamide |
| PubChem CID | 70321993 |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | 1-methyl-2,3-dihydro-1H-indene-5-carboxamide |
| SMILES | CC1CCc2cc(C(N)=O)ccc21 |
| InChI | InChI=1S/C11H13NO/c1-7-2-3-8-6-9(11(12)13)4-5-10(7)8/h4-7H,2-3H2,1H3,(H2,12,13) |
| InChIKey | HFCJKYRVFDZVDA-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-methyl-2,3-dihydro-1H-indene-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-2,3-dihydro-1H-indene-5-carboxamide?
The IUPAC name of 1-methyl-2,3-dihydro-1H-indene-5-carboxamide (CID 70321993) is 1-methyl-2,3-dihydro-1H-indene-5-carboxamide.
What is the SMILES notation for 1-methyl-2,3-dihydro-1H-indene-5-carboxamide?
The canonical SMILES for 1-methyl-2,3-dihydro-1H-indene-5-carboxamide is CC1CCc2cc(C(N)=O)ccc21.
What is the InChIKey of 1-methyl-2,3-dihydro-1H-indene-5-carboxamide?
The InChIKey is HFCJKYRVFDZVDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO/c1-7-2-3-8-6-9(11(12)13)4-5-10(7)8/h4-7H,2-3H2,1H3,(H2,12,13).
What are the key properties of 1-methyl-2,3-dihydro-1H-indene-5-carboxamide?
1-methyl-2,3-dihydro-1H-indene-5-carboxamide has a molecular weight of 175.23 g/mol, XLogP of 1.84, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-2,3-dihydro-1H-indene-5-carboxamide is sourced from PubChem (CID 70321993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).