About 4-iodo-1,2-dihydropyridin-6-amine
4-iodo-1,2-dihydropyridin-6-amine (PubChem CID 70323166) has the molecular formula C5H7IN2
and a molecular weight of 222.03 g/mol. Its IUPAC name is 4-iodo-1,2-dihydropyridin-6-amine.
Molecular Properties
| Compound Name | 4-iodo-1,2-dihydropyridin-6-amine |
| PubChem CID | 70323166 |
| Molecular Formula | C5H7IN2 |
| Molecular Weight | 222.03 g/mol |
| Exact Mass | 221.97 |
| IUPAC Name | 4-iodo-1,2-dihydropyridin-6-amine |
| SMILES | NC1=CC(I)=CCN1 |
| InChI | InChI=1S/C5H7IN2/c6-4-1-2-8-5(7)3-4/h1,3,8H,2,7H2 |
| InChIKey | PFUXLIURIDLNJT-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.03 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-iodo-1,2-dihydropyridin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-iodo-1,2-dihydropyridin-6-amine?
The IUPAC name of 4-iodo-1,2-dihydropyridin-6-amine (CID 70323166) is 4-iodo-1,2-dihydropyridin-6-amine.
What is the SMILES notation for 4-iodo-1,2-dihydropyridin-6-amine?
The canonical SMILES for 4-iodo-1,2-dihydropyridin-6-amine is NC1=CC(I)=CCN1.
What is the InChIKey of 4-iodo-1,2-dihydropyridin-6-amine?
The InChIKey is PFUXLIURIDLNJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7IN2/c6-4-1-2-8-5(7)3-4/h1,3,8H,2,7H2.
What are the key properties of 4-iodo-1,2-dihydropyridin-6-amine?
4-iodo-1,2-dihydropyridin-6-amine has a molecular weight of 222.03 g/mol, XLogP of 0.71, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-iodo-1,2-dihydropyridin-6-amine is sourced from PubChem (CID 70323166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).