About tricyclo[3.3.1.13,7]dec-3-en-1-amine
tricyclo[3.3.1.13,7]dec-3-en-1-amine (PubChem CID 70323249) has the molecular formula C10H15N
and a molecular weight of 149.24 g/mol. Its IUPAC name is tricyclo[3.3.1.13,7]dec-3-en-1-amine.
Molecular Properties
| Compound Name | tricyclo[3.3.1.13,7]dec-3-en-1-amine |
| PubChem CID | 70323249 |
| Molecular Formula | C10H15N |
| Molecular Weight | 149.24 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | tricyclo[3.3.1.13,7]dec-3-en-1-amine |
| SMILES | NC12CC3=CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C10H15N/c11-10-4-7-1-8(5-10)3-9(2-7)6-10/h1,7,9H,2-6,11H2 |
| InChIKey | CRXFGOHVDDDADG-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.24 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tricyclo[3.3.1.13,7]dec-3-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tricyclo[3.3.1.13,7]dec-3-en-1-amine?
The IUPAC name of tricyclo[3.3.1.13,7]dec-3-en-1-amine (CID 70323249) is tricyclo[3.3.1.13,7]dec-3-en-1-amine.
What is the SMILES notation for tricyclo[3.3.1.13,7]dec-3-en-1-amine?
The canonical SMILES for tricyclo[3.3.1.13,7]dec-3-en-1-amine is NC12CC3=CC(CC(C3)C1)C2.
What is the InChIKey of tricyclo[3.3.1.13,7]dec-3-en-1-amine?
The InChIKey is CRXFGOHVDDDADG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N/c11-10-4-7-1-8(5-10)3-9(2-7)6-10/h1,7,9H,2-6,11H2.
What are the key properties of tricyclo[3.3.1.13,7]dec-3-en-1-amine?
tricyclo[3.3.1.13,7]dec-3-en-1-amine has a molecular weight of 149.24 g/mol, XLogP of 1.83, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tricyclo[3.3.1.13,7]dec-3-en-1-amine is sourced from PubChem (CID 70323249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).