About 7-(4-fluorocyclohexa-2,4-dien-1-yl)-7-(4-fluorophenyl)hept-1-en-2-amine
7-(4-fluorocyclohexa-2,4-dien-1-yl)-7-(4-fluorophenyl)hept-1-en-2-amine (PubChem CID 70323326) has the molecular formula C19H23F2N
and a molecular weight of 303.40 g/mol. Its IUPAC name is 7-(4-fluorocyclohexa-2,4-dien-1-yl)-7-(4-fluorophenyl)hept-1-en-2-amine.
Molecular Properties
| Compound Name | 7-(4-fluorocyclohexa-2,4-dien-1-yl)-7-(4-fluorophenyl)hept-1-en-2-amine |
| PubChem CID | 70323326 |
| Molecular Formula | C19H23F2N |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | 7-(4-fluorocyclohexa-2,4-dien-1-yl)-7-(4-fluorophenyl)hept-1-en-2-amine |
| SMILES | C=C(N)CCCCC(c1ccc(F)cc1)C1C=CC(F)=CC1 |
| InChI | InChI=1S/C19H23F2N/c1-14(22)4-2-3-5-19(15-6-10-17(20)11-7-15)16-8-12-18(21)13-9-16/h6-8,10-13,16,19H,1-5,9,22H2 |
| InChIKey | HCQZSKKGETZJIR-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 7-(4-fluorocyclohexa-2,4-dien-1-yl)-7-(4-fluorophenyl)hept-1-en-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(4-fluorocyclohexa-2,4-dien-1-yl)-7-(4-fluorophenyl)hept-1-en-2-amine?
The IUPAC name of 7-(4-fluorocyclohexa-2,4-dien-1-yl)-7-(4-fluorophenyl)hept-1-en-2-amine (CID 70323326) is 7-(4-fluorocyclohexa-2,4-dien-1-yl)-7-(4-fluorophenyl)hept-1-en-2-amine.
What is the SMILES notation for 7-(4-fluorocyclohexa-2,4-dien-1-yl)-7-(4-fluorophenyl)hept-1-en-2-amine?
The canonical SMILES for 7-(4-fluorocyclohexa-2,4-dien-1-yl)-7-(4-fluorophenyl)hept-1-en-2-amine is C=C(N)CCCCC(c1ccc(F)cc1)C1C=CC(F)=CC1.
What is the InChIKey of 7-(4-fluorocyclohexa-2,4-dien-1-yl)-7-(4-fluorophenyl)hept-1-en-2-amine?
The InChIKey is HCQZSKKGETZJIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23F2N/c1-14(22)4-2-3-5-19(15-6-10-17(20)11-7-15)16-8-12-18(21)13-9-16/h6-8,10-13,16,19H,1-5,9,22H2.
What are the key properties of 7-(4-fluorocyclohexa-2,4-dien-1-yl)-7-(4-fluorophenyl)hept-1-en-2-amine?
7-(4-fluorocyclohexa-2,4-dien-1-yl)-7-(4-fluorophenyl)hept-1-en-2-amine has a molecular weight of 303.40 g/mol, XLogP of 5.37, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(4-fluorocyclohexa-2,4-dien-1-yl)-7-(4-fluorophenyl)hept-1-en-2-amine is sourced from PubChem (CID 70323326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).