C21H26F3N9O2 — CID 70324325
5-[(1S,4S)-2,5-diazabicyclo[2.2.1]heptan-2-yl]-3-(ethoxymethyl)-N-pyrimidin-4-yl-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazolo[4,5-d]pyrimidin-7-amine (PubChem CID 70324325) has the molecular formula C21H26F3N9O2 and a molecular weight of 493.49 g/mol. Its IUPAC name is 5-[(1S,4S)-2,5-diazabicyclo[2.2.1]heptan-2-yl]-3-(ethoxymethyl)-N-pyrimidin-4-yl-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazolo[4,5-d]pyrimidin-7-amine.
| Compound Name | 5-[(1S,4S)-2,5-diazabicyclo[2.2.1]heptan-2-yl]-3-(ethoxymethyl)-N-pyrimidin-4-yl-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazolo[4,5-d]pyrimidin-7-amine |
|---|---|
| PubChem CID | 70324325 |
| Molecular Formula | C21H26F3N9O2 |
| Molecular Weight | 493.49 g/mol |
| Exact Mass | 493.22 |
| IUPAC Name | 5-[(1S,4S)-2,5-diazabicyclo[2.2.1]heptan-2-yl]-3-(ethoxymethyl)-N-pyrimidin-4-yl-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazolo[4,5-d]pyrimidin-7-amine |
| SMILES | CCOCc1nn(CCOCC(F)(F)F)c2c(Nc3ccncn3)nc(N3C[C@@H]4C[C@H]3CN4)nc12 |
| InChI | InChI=1S/C21H26F3N9O2/c1-2-34-10-15-17-18(33(31-15)5-6-35-11-21(22,23)24)19(28-16-3-4-25-12-27-16)30-20(29-17)32-9-13-7-14(32)8-26-13/h3-4,12-14,26H,2,5-11H2,1H3,(H,25,27,28,29,30)/t13-,14-/m0/s1 |
| InChIKey | FYFPAAXUZQVIRV-KBPBESRZSA-N |
| XLogP | 2.03 |
| TPSA | 115.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.49 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|