C19H18F3N5 — CID 70324409
(4R)-1-(3-methylpyrido[2,3-b]pyrazin-6-yl)-4-(2,4,5-trifluorophenyl)piperidin-3-amine (PubChem CID 70324409) has the molecular formula C19H18F3N5 and a molecular weight of 373.38 g/mol. Its IUPAC name is (4R)-1-(3-methylpyrido[2,3-b]pyrazin-6-yl)-4-(2,4,5-trifluorophenyl)piperidin-3-amine.
| Compound Name | (4R)-1-(3-methylpyrido[2,3-b]pyrazin-6-yl)-4-(2,4,5-trifluorophenyl)piperidin-3-amine |
|---|---|
| PubChem CID | 70324409 |
| Molecular Formula | C19H18F3N5 |
| Molecular Weight | 373.38 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | (4R)-1-(3-methylpyrido[2,3-b]pyrazin-6-yl)-4-(2,4,5-trifluorophenyl)piperidin-3-amine |
| SMILES | Cc1cnc2ccc(N3CC[C@H](c4cc(F)c(F)cc4F)C(N)C3)nc2n1 |
| InChI | InChI=1S/C19H18F3N5/c1-10-8-24-17-2-3-18(26-19(17)25-10)27-5-4-11(16(23)9-27)12-6-14(21)15(22)7-13(12)20/h2-3,6-8,11,16H,4-5,9,23H2,1H3/t11-,16?/m1/s1 |
| InChIKey | ZSOXSUMQBZSZNP-ZVDHGWRTSA-N |
| XLogP | 3.07 |
| TPSA | 67.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.38 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|