C28H30N8O6 — CID 70324590
4-(dihydroxyamino)oxybutyl 5-[2-[4-[(2,4-dimethyl-7-oxo-5,6-dihydropyrido[2,3-d]pyrimidin-8-yl)methyl]phenyl]phenyl]tetrazole-2-carboxylate (PubChem CID 70324590) has the molecular formula C28H30N8O6 and a molecular weight of 574.60 g/mol. Its IUPAC name is 4-(dihydroxyamino)oxybutyl 5-[2-[4-[(2,4-dimethyl-7-oxo-5,6-dihydropyrido[2,3-d]pyrimidin-8-yl)methyl]phenyl]phenyl]tetrazole-2-carboxylate.
| Compound Name | 4-(dihydroxyamino)oxybutyl 5-[2-[4-[(2,4-dimethyl-7-oxo-5,6-dihydropyrido[2,3-d]pyrimidin-8-yl)methyl]phenyl]phenyl]tetrazole-2-carboxylate |
|---|---|
| PubChem CID | 70324590 |
| Molecular Formula | C28H30N8O6 |
| Molecular Weight | 574.60 g/mol |
| Exact Mass | 574.23 |
| IUPAC Name | 4-(dihydroxyamino)oxybutyl 5-[2-[4-[(2,4-dimethyl-7-oxo-5,6-dihydropyrido[2,3-d]pyrimidin-8-yl)methyl]phenyl]phenyl]tetrazole-2-carboxylate |
| SMILES | Cc1nc(C)c2c(n1)N(Cc1ccc(-c3ccccc3-c3nnn(C(=O)OCCCCON(O)O)n3)cc1)C(=O)CC2 |
| InChI | InChI=1S/C28H30N8O6/c1-18-22-13-14-25(37)34(27(22)30-19(2)29-18)17-20-9-11-21(12-10-20)23-7-3-4-8-24(23)26-31-33-35(32-26)28(38)41-15-5-6-16-42-36(39)40/h3-4,7-12,39-40H,5-6,13-17H2,1-2H3 |
| InChIKey | YINWZFDGWVLVCB-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 168.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.60 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|