About 2-[(2Z,4S)-4-methylhepta-2,6-dienyl]-2H-azirine
2-[(2Z,4S)-4-methylhepta-2,6-dienyl]-2H-azirine (PubChem CID 70324676) has the molecular formula C10H15N
and a molecular weight of 149.24 g/mol. Its IUPAC name is 2-[(2Z,4S)-4-methylhepta-2,6-dienyl]-2H-azirine.
Molecular Properties
| Compound Name | 2-[(2Z,4S)-4-methylhepta-2,6-dienyl]-2H-azirine |
| PubChem CID | 70324676 |
| Molecular Formula | C10H15N |
| Molecular Weight | 149.24 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | 2-[(2Z,4S)-4-methylhepta-2,6-dienyl]-2H-azirine |
| SMILES | C=CC[C@H](C)/C=C\CC1C=N1 |
| InChI | InChI=1S/C10H15N/c1-3-5-9(2)6-4-7-10-8-11-10/h3-4,6,8-10H,1,5,7H2,2H3/b6-4-/t9-,10?/m0/s1 |
| InChIKey | FMTZMFZDSHAFBK-YMHAIJKBSA-N |
| XLogP | 2.60 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.24 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2Z,4S)-4-methylhepta-2,6-dienyl]-2H-azirine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2Z,4S)-4-methylhepta-2,6-dienyl]-2H-azirine?
The IUPAC name of 2-[(2Z,4S)-4-methylhepta-2,6-dienyl]-2H-azirine (CID 70324676) is 2-[(2Z,4S)-4-methylhepta-2,6-dienyl]-2H-azirine.
What is the SMILES notation for 2-[(2Z,4S)-4-methylhepta-2,6-dienyl]-2H-azirine?
The canonical SMILES for 2-[(2Z,4S)-4-methylhepta-2,6-dienyl]-2H-azirine is C=CC[C@H](C)/C=C\CC1C=N1.
What is the InChIKey of 2-[(2Z,4S)-4-methylhepta-2,6-dienyl]-2H-azirine?
The InChIKey is FMTZMFZDSHAFBK-YMHAIJKBSA-N. The full InChI is InChI=1S/C10H15N/c1-3-5-9(2)6-4-7-10-8-11-10/h3-4,6,8-10H,1,5,7H2,2H3/b6-4-/t9-,10?/m0/s1.
What are the key properties of 2-[(2Z,4S)-4-methylhepta-2,6-dienyl]-2H-azirine?
2-[(2Z,4S)-4-methylhepta-2,6-dienyl]-2H-azirine has a molecular weight of 149.24 g/mol, XLogP of 2.60, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2Z,4S)-4-methylhepta-2,6-dienyl]-2H-azirine is sourced from PubChem (CID 70324676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).