C17H19FN4O — CID 70324970
2-amino-6-[3-(2-fluoro-3-pyridinyl)cyclohexa-1,5-dien-1-yl]-3,6-dimethyl-5H-pyrimidin-4-one (PubChem CID 70324970) has the molecular formula C17H19FN4O and a molecular weight of 314.36 g/mol. Its IUPAC name is 2-amino-6-[3-(2-fluoro-3-pyridinyl)cyclohexa-1,5-dien-1-yl]-3,6-dimethyl-5H-pyrimidin-4-one.
| Compound Name | 2-amino-6-[3-(2-fluoro-3-pyridinyl)cyclohexa-1,5-dien-1-yl]-3,6-dimethyl-5H-pyrimidin-4-one |
|---|---|
| PubChem CID | 70324970 |
| Molecular Formula | C17H19FN4O |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | 2-amino-6-[3-(2-fluoro-3-pyridinyl)cyclohexa-1,5-dien-1-yl]-3,6-dimethyl-5H-pyrimidin-4-one |
| SMILES | CN1C(=O)CC(C)(C2=CC(c3cccnc3F)CC=C2)N=C1N |
| InChI | InChI=1S/C17H19FN4O/c1-17(10-14(23)22(2)16(19)21-17)12-6-3-5-11(9-12)13-7-4-8-20-15(13)18/h3-4,6-9,11H,5,10H2,1-2H3,(H2,19,21) |
| InChIKey | DGVQLAZAHWYBOT-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 71.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|