About (5S)-9-[(2-cyclohexylethylamino)methyl]-6-methylundec-10-ene-1,1,5-triol
(5S)-9-[(2-cyclohexylethylamino)methyl]-6-methylundec-10-ene-1,1,5-triol (PubChem CID 70324981) has the molecular formula C21H41NO3
and a molecular weight of 355.56 g/mol. Its IUPAC name is (5S)-9-[(2-cyclohexylethylamino)methyl]-6-methylundec-10-ene-1,1,5-triol.
Molecular Properties
| Compound Name | (5S)-9-[(2-cyclohexylethylamino)methyl]-6-methylundec-10-ene-1,1,5-triol |
| PubChem CID | 70324981 |
| Molecular Formula | C21H41NO3 |
| Molecular Weight | 355.56 g/mol |
| Exact Mass | 355.31 |
| IUPAC Name | (5S)-9-[(2-cyclohexylethylamino)methyl]-6-methylundec-10-ene-1,1,5-triol |
| SMILES | C=CC(CCC(C)[C@@H](O)CCCC(O)O)CNCCC1CCCCC1 |
| InChI | InChI=1S/C21H41NO3/c1-3-18(16-22-15-14-19-8-5-4-6-9-19)13-12-17(2)20(23)10-7-11-21(24)25/h3,17-25H,1,4-16H2,2H3/t17?,18?,20-/m0/s1 |
| InChIKey | ZBYLOKAHLTXRHW-QLOJAFMTSA-N |
| XLogP | 3.61 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.56 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (5S)-9-[(2-cyclohexylethylamino)methyl]-6-methylundec-10-ene-1,1,5-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-9-[(2-cyclohexylethylamino)methyl]-6-methylundec-10-ene-1,1,5-triol?
The IUPAC name of (5S)-9-[(2-cyclohexylethylamino)methyl]-6-methylundec-10-ene-1,1,5-triol (CID 70324981) is (5S)-9-[(2-cyclohexylethylamino)methyl]-6-methylundec-10-ene-1,1,5-triol.
What is the SMILES notation for (5S)-9-[(2-cyclohexylethylamino)methyl]-6-methylundec-10-ene-1,1,5-triol?
The canonical SMILES for (5S)-9-[(2-cyclohexylethylamino)methyl]-6-methylundec-10-ene-1,1,5-triol is C=CC(CCC(C)[C@@H](O)CCCC(O)O)CNCCC1CCCCC1.
What is the InChIKey of (5S)-9-[(2-cyclohexylethylamino)methyl]-6-methylundec-10-ene-1,1,5-triol?
The InChIKey is ZBYLOKAHLTXRHW-QLOJAFMTSA-N. The full InChI is InChI=1S/C21H41NO3/c1-3-18(16-22-15-14-19-8-5-4-6-9-19)13-12-17(2)20(23)10-7-11-21(24)25/h3,17-25H,1,4-16H2,2H3/t17?,18?,20-/m0/s1.
What are the key properties of (5S)-9-[(2-cyclohexylethylamino)methyl]-6-methylundec-10-ene-1,1,5-triol?
(5S)-9-[(2-cyclohexylethylamino)methyl]-6-methylundec-10-ene-1,1,5-triol has a molecular weight of 355.56 g/mol, XLogP of 3.61, 14 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-9-[(2-cyclohexylethylamino)methyl]-6-methylundec-10-ene-1,1,5-triol is sourced from PubChem (CID 70324981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).