About 3-(1,1-difluoroethyl)-2-methoxy-N-(2-methyl-1-phenyl-2-pyrrolidin-1-ylpropyl)benzamide
3-(1,1-difluoroethyl)-2-methoxy-N-(2-methyl-1-phenyl-2-pyrrolidin-1-ylpropyl)benzamide (PubChem CID 70325594) has the molecular formula C24H30F2N2O2
and a molecular weight of 416.51 g/mol. Its IUPAC name is 3-(1,1-difluoroethyl)-2-methoxy-N-(2-methyl-1-phenyl-2-pyrrolidin-1-ylpropyl)benzamide.
Molecular Properties
| Compound Name | 3-(1,1-difluoroethyl)-2-methoxy-N-(2-methyl-1-phenyl-2-pyrrolidin-1-ylpropyl)benzamide |
| PubChem CID | 70325594 |
| Molecular Formula | C24H30F2N2O2 |
| Molecular Weight | 416.51 g/mol |
| Exact Mass | 416.23 |
| IUPAC Name | 3-(1,1-difluoroethyl)-2-methoxy-N-(2-methyl-1-phenyl-2-pyrrolidin-1-ylpropyl)benzamide |
| SMILES | COc1c(C(=O)NC(c2ccccc2)C(C)(C)N2CCCC2)cccc1C(C)(F)F |
| InChI | InChI=1S/C24H30F2N2O2/c1-23(2,28-15-8-9-16-28)21(17-11-6-5-7-12-17)27-22(29)18-13-10-14-19(20(18)30-4)24(3,25)26/h5-7,10-14,21H,8-9,15-16H2,1-4H3,(H,27,29) |
| InChIKey | XTZKXSMNKGNNTE-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 416.51 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(1,1-difluoroethyl)-2-methoxy-N-(2-methyl-1-phenyl-2-pyrrolidin-1-ylpropyl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,1-difluoroethyl)-2-methoxy-N-(2-methyl-1-phenyl-2-pyrrolidin-1-ylpropyl)benzamide?
The IUPAC name of 3-(1,1-difluoroethyl)-2-methoxy-N-(2-methyl-1-phenyl-2-pyrrolidin-1-ylpropyl)benzamide (CID 70325594) is 3-(1,1-difluoroethyl)-2-methoxy-N-(2-methyl-1-phenyl-2-pyrrolidin-1-ylpropyl)benzamide.
What is the SMILES notation for 3-(1,1-difluoroethyl)-2-methoxy-N-(2-methyl-1-phenyl-2-pyrrolidin-1-ylpropyl)benzamide?
The canonical SMILES for 3-(1,1-difluoroethyl)-2-methoxy-N-(2-methyl-1-phenyl-2-pyrrolidin-1-ylpropyl)benzamide is COc1c(C(=O)NC(c2ccccc2)C(C)(C)N2CCCC2)cccc1C(C)(F)F.
What is the InChIKey of 3-(1,1-difluoroethyl)-2-methoxy-N-(2-methyl-1-phenyl-2-pyrrolidin-1-ylpropyl)benzamide?
The InChIKey is XTZKXSMNKGNNTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H30F2N2O2/c1-23(2,28-15-8-9-16-28)21(17-11-6-5-7-12-17)27-22(29)18-13-10-14-19(20(18)30-4)24(3,25)26/h5-7,10-14,21H,8-9,15-16H2,1-4H3,(H,27,29).
What are the key properties of 3-(1,1-difluoroethyl)-2-methoxy-N-(2-methyl-1-phenyl-2-pyrrolidin-1-ylpropyl)benzamide?
3-(1,1-difluoroethyl)-2-methoxy-N-(2-methyl-1-phenyl-2-pyrrolidin-1-ylpropyl)benzamide has a molecular weight of 416.51 g/mol, XLogP of 5.15, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,1-difluoroethyl)-2-methoxy-N-(2-methyl-1-phenyl-2-pyrrolidin-1-ylpropyl)benzamide is sourced from PubChem (CID 70325594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).