About (5S)-1-fluoro-2,5-dimethylcyclohexa-1,3-diene
(5S)-1-fluoro-2,5-dimethylcyclohexa-1,3-diene (PubChem CID 70325778) has the molecular formula C8H11F
and a molecular weight of 126.17 g/mol. Its IUPAC name is (5S)-1-fluoro-2,5-dimethylcyclohexa-1,3-diene.
Molecular Properties
| Compound Name | (5S)-1-fluoro-2,5-dimethylcyclohexa-1,3-diene |
| PubChem CID | 70325778 |
| Molecular Formula | C8H11F |
| Molecular Weight | 126.17 g/mol |
| Exact Mass | 126.08 |
| IUPAC Name | (5S)-1-fluoro-2,5-dimethylcyclohexa-1,3-diene |
| SMILES | CC1=C(F)C[C@H](C)C=C1 |
| InChI | InChI=1S/C8H11F/c1-6-3-4-7(2)8(9)5-6/h3-4,6H,5H2,1-2H3/t6-/m1/s1 |
| InChIKey | CHKBYOTYLXKLCN-ZCFIWIBFSA-N |
| XLogP | 2.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.17 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze (5S)-1-fluoro-2,5-dimethylcyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-1-fluoro-2,5-dimethylcyclohexa-1,3-diene?
The IUPAC name of (5S)-1-fluoro-2,5-dimethylcyclohexa-1,3-diene (CID 70325778) is (5S)-1-fluoro-2,5-dimethylcyclohexa-1,3-diene.
What is the SMILES notation for (5S)-1-fluoro-2,5-dimethylcyclohexa-1,3-diene?
The canonical SMILES for (5S)-1-fluoro-2,5-dimethylcyclohexa-1,3-diene is CC1=C(F)C[C@H](C)C=C1.
What is the InChIKey of (5S)-1-fluoro-2,5-dimethylcyclohexa-1,3-diene?
The InChIKey is CHKBYOTYLXKLCN-ZCFIWIBFSA-N. The full InChI is InChI=1S/C8H11F/c1-6-3-4-7(2)8(9)5-6/h3-4,6H,5H2,1-2H3/t6-/m1/s1.
What are the key properties of (5S)-1-fluoro-2,5-dimethylcyclohexa-1,3-diene?
(5S)-1-fluoro-2,5-dimethylcyclohexa-1,3-diene has a molecular weight of 126.17 g/mol, XLogP of 2.83, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-1-fluoro-2,5-dimethylcyclohexa-1,3-diene is sourced from PubChem (CID 70325778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).