About (6S)-2-chloro-1,5-difluoro-6-methylcyclohexa-1,3-diene
(6S)-2-chloro-1,5-difluoro-6-methylcyclohexa-1,3-diene (PubChem CID 70326511) has the molecular formula C7H7ClF2
and a molecular weight of 164.58 g/mol. Its IUPAC name is (6S)-2-chloro-1,5-difluoro-6-methylcyclohexa-1,3-diene.
Molecular Properties
| Compound Name | (6S)-2-chloro-1,5-difluoro-6-methylcyclohexa-1,3-diene |
| PubChem CID | 70326511 |
| Molecular Formula | C7H7ClF2 |
| Molecular Weight | 164.58 g/mol |
| Exact Mass | 164.02 |
| IUPAC Name | (6S)-2-chloro-1,5-difluoro-6-methylcyclohexa-1,3-diene |
| SMILES | C[C@@H]1C(F)=C(Cl)C=CC1F |
| InChI | InChI=1S/C7H7ClF2/c1-4-6(9)3-2-5(8)7(4)10/h2-4,6H,1H3/t4-,6?/m0/s1 |
| InChIKey | HFSPTSVINJZQAB-VKZKZBKNSA-N |
| XLogP | 2.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.58 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze (6S)-2-chloro-1,5-difluoro-6-methylcyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6S)-2-chloro-1,5-difluoro-6-methylcyclohexa-1,3-diene?
The IUPAC name of (6S)-2-chloro-1,5-difluoro-6-methylcyclohexa-1,3-diene (CID 70326511) is (6S)-2-chloro-1,5-difluoro-6-methylcyclohexa-1,3-diene.
What is the SMILES notation for (6S)-2-chloro-1,5-difluoro-6-methylcyclohexa-1,3-diene?
The canonical SMILES for (6S)-2-chloro-1,5-difluoro-6-methylcyclohexa-1,3-diene is C[C@@H]1C(F)=C(Cl)C=CC1F.
What is the InChIKey of (6S)-2-chloro-1,5-difluoro-6-methylcyclohexa-1,3-diene?
The InChIKey is HFSPTSVINJZQAB-VKZKZBKNSA-N. The full InChI is InChI=1S/C7H7ClF2/c1-4-6(9)3-2-5(8)7(4)10/h2-4,6H,1H3/t4-,6?/m0/s1.
What are the key properties of (6S)-2-chloro-1,5-difluoro-6-methylcyclohexa-1,3-diene?
(6S)-2-chloro-1,5-difluoro-6-methylcyclohexa-1,3-diene has a molecular weight of 164.58 g/mol, XLogP of 2.95, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (6S)-2-chloro-1,5-difluoro-6-methylcyclohexa-1,3-diene is sourced from PubChem (CID 70326511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).